Acotiamide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477240986

| image = Acotiamide.svg

| width = 275

| tradename = Acofide, others

| pregnancy_category =

| routes_of_administration = By mouth

| ATC_prefix = A03

| ATC_suffix = FA10

| ATC_supplemental = {{ATCvet|A03|FA10}}

| legal_US_comment =

| legal_status = JP: Rx-only

| bioavailability =

| protein_bound = 84.21–85.95%

| metabolism = UGT1A8 and 1A9 (major)

| elimination_half-life = 10.9–21.7 hours

| excretion = Feces (92.7%), urine (5.3%){{cite web|title=Acofide (acotiamide hydrochloride hydrate) Tablets Review Report|url=https://www.pmda.go.jp/files/000153467.pdf|access-date=29 December 2016}}

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 185106-16-5

| PubChem = 5282338

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4445505

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2107723

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D42OWK5383

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D08838

| synonyms = YM-443, Z-338

| IUPAC_name = N-{2-[bis(1-Methylethyl)amino]ethyl}-2-{[(2-hydroxy-4,5-dimethoxyphenyl)carbonyl]amino}-1,3-thiazole-4-carboxamide

| C=21 | H=30 | N=4 | O=5 | S=1

| smiles = O=C(Nc1nc(C(=O)NCCN(C(C)C)C(C)C)cs1)c2cc(OC)c(OC)cc2O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H30N4O5S/c1-12(2)25(13(3)4)8-7-22-20(28)15-11-31-21(23-15)24-19(27)14-9-17(29-5)18(30-6)10-16(14)26/h9-13,26H,7-8H2,1-6H3,(H,22,28)(H,23,24,27)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = TWHZNAUBXFZMCA-UHFFFAOYSA-N

}}

Acotiamide, sold under the brand names Acofide,{{cite journal | vauthors = Nowlan ML, Scott LJ | title = Acotiamide: first global approval | journal = Drugs | volume = 73 | issue = 12 | pages = 1377–83 | date = August 2013 | pmid = 23881665 | doi = 10.1007/s40265-013-0100-9 | s2cid = 20383853 }}{{cite journal | vauthors = Matsunaga Y, Tanaka T, Saito Y, Kato H, Takei M | title = [Pharmacological and clinical profile of acotiamide hydrochloride hydrate (Acofide(®) Tablets 100 mg), a novel therapeutic agent for functional dyspepsia (FD)] | language = Japanese | journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica | volume = 143 | issue = 2 | pages = 84–94 | date = February 2014 | pmid = 24531902 | doi = 10.1254/fpj.143.84 | doi-access = free }} and Dyspevict is a medication manufactured and approved in Japan and Russia{{cite web |title=Dyspevict (acotiamide) Film-Coated Tablets. Full Prescribing Information |url=https://grls.rosminzdrav.ru/Grls_View_v2.aspx?routingGuid=db683eda-6e52-4f31-bf03-d33525578ba4 |website=Russian State Register of Medicines |publisher=Dr. Reddy's Laboratories |access-date=4 April 2025 |language=ru}} for the treatment of postprandial fullness, upper abdominal bloating, and early satiation due to functional dyspepsia.{{cite journal | vauthors = Matsueda K, Hongo M, Tack J, Aoki H, Saito Y, Kato H | title = Clinical trial: dose-dependent therapeutic efficacy of acotiamide hydrochloride (Z-338) in patients with functional dyspepsia - 100 mg t.i.d. is an optimal dosage | journal = Neurogastroenterology and Motility | volume = 22 | issue = 6 | pages = 618–e173 | date = June 2010 | pmid = 20059698 | doi = 10.1111/j.1365-2982.2009.01449.x | s2cid = 41298446 }} It acts as an acetylcholinesterase inhibitor.