Acriflavine
{{more medical citations needed|date=December 2016}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477241203
| ImageFile = Acriflavine.png
| ImageName = Wireframe of acriflavine
| ImageFile2 = Acriflavinium chloride substance photo.jpg
| ImageCaption2 = Sample of pure acriflavine
| ImageAlt2 = Pure acriflavinium chloride: A brown powder
| PIN = 3,6-Diamino-10-methylacridin-10-ium chloride
| OtherNames = Acriflavinium chloride (INN)
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1T3A50395T
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = 1S73VW819C
| UNII1_Comment = (HCl)
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 354349
| SMILES1 = [Cl-].n1c3c(cc2c1cc(N)cc2)ccc(c3)N.Nc3cc2[n+](c1cc(N)ccc1cc2cc3)C
| InChI = 1S/C14H13N3.C13H11N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;/h2-8H,1H3,(H3,15,16);1-7H,14-15H2;1H
| InChIKey = PEJLNXHANOHNSU-UHFFFAOYSA-N
| InChIKey1 = PEJLNXHANOHNSU-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 65589-70-0
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo1 = 10597-46-3
| CASNo1_Comment = (HCl)
| PubChem = 443101
| PubChem1 = 15558347
| PubChem1_Comment = (HCl)
| ChemSpiderID = 391386
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 21018
| ChemSpiderID1_Comment = (HCl)
| EINECS = 201-668-8
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 383703
| SMILES = [Cl-].C[N+]1=C2C=C(N)C=CC2=CC2=C1C=C(N)C=C2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C14H13N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;/h2-8H,1H3,(H3,15,16);1H
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = KKAJSJJFBSOMGS-UHFFFAOYSA-N}}
|Section2={{Chembox Properties
| C=14 | H=14 | Cl=1 | N=3}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = R02
| ATCCode_suffix = AA13
| ATC_Supplemental = {{ATCvet|G01|AC90}}
}}
}}
Acriflavine (INN: acriflavinium chloride) is a topical antiseptic. It has the form of an orange or brown powder. It may be harmful in the eyes or if inhaled. It is a dye and it stains the skin and may irritate. The hydrochloride form is more irritating than the neutral form.
It is derived from acridine. Commercial preparations are often mixtures with proflavine.{{cite web | url = http://www.sigmaaldrich.com/catalog/product/sigma/a8126?lang=en | title = Acriflavine | publisher = Sigma-Aldrich}} It is known by a variety of commercial names.
Uses
=Medical use=
Acriflavine was developed in 1912 by Paul Ehrlich, a German medical researcher, and was used during the First World War against sleeping sickness and as a topical antiseptic.[http://www.britannica.com/science/acriflavine acriflavine Encyclopædia Britannica]
=Other uses=
Acriflavine is used in biochemistry for fluorescently labeling high molecular weight RNA.
It is used as treatment for external fungal infections of aquarium fish.{{Cite web |url=http://freshaquarium.about.com/od/Fish_Health_Treatments/fl/Acriflavine.htm |title=Acriflavine use in aquaria |access-date=2016-01-24 |archive-date=2016-01-29 |archive-url=https://web.archive.org/web/20160129182528/http://freshaquarium.about.com/od/Fish_Health_Treatments/fl/Acriflavine.htm |url-status=dead }}
Research
Acriflavine might be effective in fighting common cold virus, and also aid the fight against increasingly antibiotic resistant bacteria{{cite news | url = http://www.abc.net.au/news/2016-11-28/antiseptic-used-in-wwi-could-hold-key-to-treating-superbugs/8062496 | title = Antiseptic used in WWI could hold key to treating superbugs, viral infections, Melbourne researchers say | publisher = ABC | date = November 28, 2016}}{{cite news | url = http://www.sciencealert.com/this-forgotten-wwi-antiseptic-could-be-the-key-to-fighting-antibiotic-resistance | title = This forgotten WWI antiseptic could be the key to fighting antibiotic resistance | publisher = Science Alert | date = November 30, 2016}}{{Cite journal | doi = 10.1093/nar/gkw878 | title = Activation of cGAS-dependent antiviral responses by DNA intercalating agents | journal = Nucleic Acids Research | year = 2016 | pmid = 27694309| pmc = 5224509| volume=45 | issue = 1 | pages=198–205| last1 = Pépin | first1 = Geneviève | last2 = Nejad | first2 = Charlotte | last3 = Thomas | first3 = Belinda J | last4 = Ferrand | first4 = Jonathan | last5 = McArthur | first5 = Kate | last6 = Bardin | first6 = Philip G | last7 = Williams | first7 = Bryan RG | last8 = Gantier | first8 = Michael P }} because it can cure (remove) plasmids containing antimicrobial resistance genes from Gram positive bacteria.{{Cite journal | doi = 10.1016/S0147-619X(03)00074-X | pmid = 14711527 | title = Plasmid curing of Oenococcus oeni. | journal = Plasmid | year = 2004 | volume=51 | issue = 1 | pages=37–40| last1 = Mesas | first1 = J.M. | last2 = Rodriguez | first2 = M.C. | last3 = Alegre | first3 = M.T.}}
Since 2014, acriflavine has been undergoing testing as an antimalarial drug to treat parasites with resistance to quinine and modern anti-parasitic medicines.{{Cite journal | doi = 10.1021/cb500476q| pmid = 25089658| title = Potent Antimalarial Activity of Acriflavine In Vitroand In Vivo| journal = ACS Chemical Biology| volume = 9| issue = 10| pages = 2366–73| year = 2014| last1 = Dana| first1 = Srikanta| last2 = Prusty| first2 = Dhaneswar| last3 = Dhayal| first3 = Devender| last4 = Gupta| first4 = Mohit Kumar| last5 = Dar| first5 = Ashraf| last6 = Sen| first6 = Sobhan| last7 = Mukhopadhyay| first7 = Pritam| last8 = Adak| first8 = Tridibesh| last9 = Dhar| first9 = Suman Kumar| pmc=4201339}}
Legal status
=Australia=
Acriflavine is a controlled substance in Australia and dependent on situation,{{clarify|date=January 2016}} is considered either a Schedule 5 (Caution) or Schedule 7 (Dangerous Poison) substance. The use, storage and preparation of the chemical is subject to strict state and territory laws.{{citation needed|date=January 2016}}
References
{{Reflist}}
External links
- {{Commons category-inline}}
- [http://www.chemexper.com/chemicals/supplier/cas/8063-24-9.html ChemExper Chemical Directory]