Actaplanin

{{Chembox

| ImageFile = Actaplanin 1.png

| ImageSize = 150px

| ImageAlt =

| IUPACName =

| OtherNames = Antibiotic A 4696, Kamoran

|Section1={{Chembox Identifiers

| CASNo = 37305-75-2

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 17289019

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BIC0KCT1E9

| PubChem = 16132360

| StdInChI=1S/C90H101ClN8O40/c1-29-47-18-35(19-48(29)132-88-75(116)71(112)67(108)54(26-101)135-88)61-83(122)97-62-36-20-51(129-38-9-4-31(5-10-38)14-43(80(119)95-61)94-81(120)59(93)32-6-12-45(105)49(17-32)131-47)79(139-90-77(118)73(114)69(110)56(137-90)28-127-87-74(115)70(111)66(107)53(25-100)134-87)52(21-36)130-46-13-8-34(16-41(46)91)78(138-57-24-42(92)65(106)30(2)128-57)64-85(124)98-63(86(125)126-3)40-22-37(103)23-50(133-89-76(117)72(113)68(109)55(27-102)136-89)58(40)39-15-33(7-11-44(39)104)60(82(121)99-64)96-84(62)123/h4-13,15-23,30,42-43,53-57,59-78,87-90,100-118H,14,24-28,92-93H2,1-3H3,(H,94,120)(H,95,119)(H,96,123)(H,97,122)(H,98,124)(H,99,121)

| StdInChIKey = PFEBYWJUETVBLJ-UHFFFAOYSA-N

| SMILES = CC1C(C(CC(O1)OC2C3C(=O)NC(C4=C(C(=CC(=C4)O)OC5C(C(C(C(O5)CO)O)O)O)C6=C(C=CC(=C6)C(C(=O)N3)NC(=O)C7C8=CC(=C(C(=C8)OC9=C(C=C2C=C9)Cl)OC1C(C(C(C(O1)COC1C(C(C(C(O1)CO)O)O)O)O)O)O)OC1=CC=C(CC2C(=O)NC(C3=CC(=C(C(=C3)OC3C(C(C(C(O3)CO)O)O)O)C)OC3=C(C=CC(=C3)C(C(=O)N2)N)O)C(=O)N7)C=C1)O)C(=O)OC)N)O

}}

|Section2={{Chembox Properties

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Actaplanin is a complex of broad-spectrum antibiotics made by Actinoplanes bacteria.{{cite journal|last1=Debono|first1=Manuel|last2=Merkel|first2=Kurt E.|last3=Molloy|first3=R. Michael|last4=Barnhart|first4=Mitchell|last5=Presti|first5=Eugene|last6=Hunt|first6=Ann H.|last7=Hamill|first7=Robert L.|title=Actaplanin, new glycopeptide antibiotics produced by Actinoplanes missouriensis. The isolation and preliminary chemical characterization of actaplanin|journal=The Journal of Antibiotics|date=1984|volume=37|issue=2|pages=85–95|doi=10.7164/antibiotics.37.85|pmid=6706856|doi-access=free}}{{cite journal|last1=Huber|first1=Floyd M.|last2=Pieper|first2=Richard L.|last3=Tietz|first3=Anthony J.|title=Characterization of the process for the biosynthesis of the actaplanin complex by Actinoplanes missouriensis|journal=Journal of Fermentation Technology|date=January 1987|volume=65|issue=1|pages=85–89|doi=10.1016/0385-6380(87)90069-0}} Research carried out by a group in Eli Lilly and Co. in 1984 identified several actaplanins using high-performance liquid chromatography.{{cite journal|last1=Debono|first1=Manuel|last2=Merkel|first2=Kurt E.|last3=Molloy|first3=R. Michael|last4=Barnhart|first4=Mitchell|last5=Presti|first5=Eugene|last6=Hunt|first6=Ann H.|last7=Hamill|first7=Robert L.|title=Actaplanin, new glycopeptide antibiotics produced by Actinoplanes missouriensis. The isolation and preliminary chemical characterization of actaplanin.|journal=The Journal of Antibiotics|date=1984|volume=37|issue=2|pages=85–95|doi=10.7164/antibiotics.37.85|pmid=6706856|url=https://www.jstage.jst.go.jp/article/antibiotics1968/37/2/37_2_85/_article/-char/ja/|accessdate=25 December 2014|doi-access=free}}{{ cite patent

| country = US

| number = 4115552

| status =

| title = Factor A and B of antibiotic A-4696

| pubdate = 19 Sep 1978

| gdate =

| fdate =

| pridate = 19 Apr 1976

| inventor = Robert L Hamill

| invent1 = William M Stark

| invent2 = Donald C Delong

| assign1 = Eli Lilly And Company

| assign2 =

| class = }}{{ cite patent

| country = US

| number = 4322406

| status =

| title = Antibiotic A-4696 factors B1, B2, B3, C1a, C3 and E1

| pubdate = 30 Mar 1982

| gdate =

| fdate = 18 Dec 1980

| pridate = 18 Dec 1980

| inventor = Manuel Debono

| invent1 = Kurt E. Merkel

| invent2 = Robert E. Weeks

| invent3 = Herald J. Cole

| assign1 = Eli Lilly And Company

| assign2 =

| class =}} Actaplanins A, B1, B2, B3, C1 and G were shown to be composed of the same peptide core, an amino sugar, and varying amounts of glucose, mannose, and rhamnose.{{cite journal|last1=Hunt|first1=Ann H.|last2=Elzey|first2=Thomas K.|last3=Merkel|first3=Kurt E.|last4=Debono|first4=Manuel|title=Structures of the actaplanins|journal=The Journal of Organic Chemistry|date=February 1984|volume=49|issue=4|pages=641–645|doi=10.1021/jo00178a012}}

See also

  • Ristocetin (contains the same amino sugar as in actaplanin)

References