Actinonin
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 477241675
| ImageFile = Actinonin.svg
| ImageSize = 200px
| PIN = (2R)-N4-Hydroxy-N1-{(2S)-1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl}-2-pentylbutanediamide
| OtherNames = HONH-Val-Pro-OH (IUPAC peptide linear)
|Section1={{Chembox Identifiers
| CASNo = 13434-13-4
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P18SPA8N0K
| PubChem = 443600
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 308333
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 391756
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04310
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H35N3O5/c1-4-5-6-8-14(11-16(24)21-27)18(25)20-17(13(2)3)19(26)22-10-7-9-15(22)12-23/h13-15,17,23,27H,4-12H2,1-3H3,(H,20,25)(H,21,24)/t14-,15+,17+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XJLATMLVMSFZBN-VYDXJSESSA-N
| SMILES = O=C(N1[C@H](CO)CCC1)[C@@H](NC(=O)[C@H](CCCCC)CC(=O)NO)C(C)C
| InChI = InChI=1S/C19H35N3O5/c1-4-5-6-8-14(11-16(24)21-27)18(25)20-17(13(2)3)19(26)22-10-7-9-15(22)12-23/h13-15,17,23,27H,4-12H2,1-3H3,(H,20,25)(H,21,24)/t14-,15+,17+/m1/s1
}}
|Section2={{Chembox Properties
| C=19 | H=35 | N=3 | O=5
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Actinonin is a naturally occurring antibacterial agent that has demonstrated anti-tumor activity.{{cite journal | last1 = Chen | first1 = D.Z. | last2 = Patel | first2 = D.V. | title = Actinonin, a Naturally Occurring Antibacterial Agent, Is a Potent Deformylase Inhibitor | journal = Biochemistry | volume = 39 | pages = 1256–62 | year = 2000 | doi = 10.1021/bi992245y | pmid=10684604 | issue=6}}
Actiononin has been shown to inhibit the enzyme peptide deformylase, which is essential in bacteria.{{Cite journal|last1=Yoon|first1=Hye-Jin|last2=Kim|first2=Hye Lee|last3=Lee|first3=Soo-Kyoung|last4=Kim|first4=Hyun-Woo|last5=Kim|first5=Hyung-Wook|last6=Lee|first6=Jae Young|last7=Mikami|first7=Bunzo|last8=Suh|first8=Se Won|date=2004|title=Crystal structure of peptide deformylase from Staphylococcus aureus in complex with actinonin, a naturally occurring antibacterial agent|url=https://onlinelibrary.wiley.com/doi/abs/10.1002/prot.20231|journal=Proteins: Structure, Function, and Bioinformatics|language=en|volume=57|issue=3|pages=639–642|doi=10.1002/prot.20231|pmid=15382235|s2cid=42929776|issn=1097-0134|url-access=subscription}}