Adenosine 5'-tetraphosphate

{{Multiple issues|{{primary sources|date=May 2017}}{{technical|date=May 2017}}}}

{{Chembox

| ImageFile = Adenosine tetraphosphate.svg

| ImageSize = 200px

| IUPACName = Adenosine 5′-(pentahydrogen tetraphosphate)

| SystematicName = O¹-{[(2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl} pentahydrogen tetraphosphate

| OtherNames = Adenosine tetraphosphate

| Section1 = {{Chembox Identifiers

| CASNo = 1062-98-2

| CASNo_Ref = {{Cascite|changed|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = DBK98M4ZT7

| ChEBI = 18334

| ChEMBL = 490984

| ChemSpiderID = 13390

| KEGG = C03483

| PubChem = 14003

| SMILES = Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O

| InChI=1S/C10H17N5O16P4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(28-10)1-27-33(21,22)30-35(25,26)31-34(23,24)29-32(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H,25,26)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1

| InChIKey=WWMWAMFHUSTZTA-KQYNXXCUSA-N

}}

| Section2 = {{Chembox Properties

| C=10|H=17|N=5|O=16|P=4

}}

}}

Adenosine 5′-tetraphosphate, Ap4 or ATPP is a nucleotide. It is produced from ATP and triphosphate (P₃) through the action of acetyl—CoA synthetase.{{cite journal| author1=Guranowski, A.|author2=Günther Sillero, M.A.|author3=Sillero, A.| title=Adenosine 5′-tetraphosphate and adenosine 5′-pentaphosphate are synthesized by yeast acetyl coenzyme A synthetase.| journal=J Bacteriol | year= 1994 | volume= 176 | issue= 10 | pages= 2986–90 | pmid=7910605 | doi= 10.1128/jb.176.10.2986-2990.1994| pmc=205455 }} Acetyl—CoA synthetase also produces adenosine 5'-pentaphosphate through the reaction of ADP and tetraphosphate (P₄).