Adrenosterone
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477243123
| ImageFile = Adrenosterone.png
| ImageSize = 250
| IUPACName = Androst-4-ene-3,11,17-trione
| SystematicName = (3aS,3bS,9aR,9bS,11aS)-9a,11a-Dimethyl-2,3,3a,3b,4,5,8,9,9a,9b,11,11a-dodecahydro-1H-cyclopenta[a]phenanthrene-1,7,10-trione
| OtherNames =Reichstein's substance G
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 194597
| ChEBI = 2495
| InChI = 1/C19H24O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-14,17H,3-8,10H2,1-2H3/t13-,14-,17+,18-,19-/m0/s1
| InChIKey = RZRPTBIGEANTGU-IRIMSJTPBG
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H24O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-14,17H,3-8,10H2,1-2H3/t13-,14-,17+,18-,19-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RZRPTBIGEANTGU-IRIMSJTPSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo =382-45-6
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 485683
| PubChem =223997
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = AE4E9102GY
| SMILES = O=C4/C=C3/CC[C@@H]2[C@H](C(=O)C[C@@]1(C(=O)CC[C@H]12)C)[C@@]3(C)CC4
| MeSHName =Adrenosterone
}}
|Section2={{Chembox Properties
| C=19 | H=24 | O=3
| MolarMass =300.39 g/mol
| Appearance =
| Density =
| MeltingPtC = 222
| MeltingPt_notes =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Adrenosterone, also known as Reichstein's substance G , as well as 11-ketoandrostenedione (11-KA4), 11-oxoandrostenedione (11-OXO), and androst-4-ene-3,11,17-trione, is a steroid hormone with an extremely weak androgenic effect, and an intermediate/prohormone of 11-ketotestosterone.{{cite journal|last1=Pretorius|first1=Elzette|last2=Arlt|first2=Wiebke|last3=Storbeck|first3=Karl-Heinz|title=A new dawn for androgens: Novel lessons from 11-oxygenated C19 steroids|journal=Molecular and Cellular Endocrinology|volume=441|pages=76–85|year=2016|issn=0303-7207|doi=10.1016/j.mce.2016.08.014|pmid=27519632|s2cid=4079662|url=http://pure-oai.bham.ac.uk/ws/files/30346231/Pretorius_et_al_manuscript.pdf}} It was first isolated in 1936 from the adrenal cortex by Tadeus Reichstein at the Pharmaceutical Institute in the University of Basel. Originally, adrenosterone was called Reichstein's substance G. Adrenosterone occurs in trace amounts in humans as well as most mammals and in larger amounts in fish, where it is a precursor to the primary androgen, 11-ketotestosterone.{{Cite journal | last1 = Blasco | first1 = M. N. | last2 = Carriquiriborde | first2 = P. | last3 = Marino | first3 = D. N. | last4 = Ronco | first4 = A. E. | last5 = Somoza | first5 = G. M. | title = A quantitative HPLC–MS method for the simultaneous determination of testosterone, 11-ketotestosterone and 11-β hydroxyandrostenedione in fish serum | doi = 10.1016/j.jchromb.2009.03.028 | journal = Journal of Chromatography B | volume = 877 | issue = 14–15 | pages = 1509–1515 | year = 2009 | pmid = 19369122}}
Adrenosterone is sold as a dietary supplement since 2007 as a fat loss and muscle gaining supplement. It is thought to be a competitive selective 11βHSD1 inhibitor, which is responsible for activation of cortisol from cortisone.{{cite journal | vauthors = Brooker L, Parr MK, Cawley A, Flenker U, Howe C, Kazlauskas R, Schänzer W, George A | title = Development of criteria for the detection of adrenosterone administration by gas chromatography-mass spectrometry and gas chromatography-combustion-isotope ratio mass spectrometry for doping control | journal = Drug Test Anal | volume = 1 | issue = 11–12 | pages = 587–95 | year = 2009 | pmid = 20355175 | doi = 10.1002/dta.108 }} Thus preventing muscle breakdown, and contributing to a majority of its effects.
See also
References
{{Reflist|2}}
{{Steroid hormones}}
{{Androgen receptor modulators}}
Category:Anabolic–androgenic steroids