Alamethicin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477316294

| Reference =[http://www.fermentek.com/alamethicin Alamethicin product page] from Fermentek

| ImageFile =Alamethicin.png

| ImageSize =250px

| IUPACName =N-acetyl-2-methylalanyl-L-prolyl-2-methylalanyl-L-alanyl-2-methylalanyl-L-alanyl-L-glutaminyl-2-methylalanyl-L-valyl-2-methylalanylglycyl-L-leucyl-2-methylalanyl-L-prolyl-L-valyl-2-methylalanyl-2-methylalanyl-L-α-glutamyl-N1-[(1S)-1-benzyl-2-hydroxyethyl]-L-glutamamide

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 17288702

| InChI = 1/C92H150N22O25/c1-47(2)43-58(72(127)108-92(24,25)84(139)113-41-29-33-59(113)73(128)103-65(48(3)4)75(130)111-90(20,21)82(137)112-89(18,19)80(135)102-56(37-40-64(120)121)70(125)101-55(35-38-61(93)117)69(124)98-54(46-115)44-53-31-27-26-28-32-53)99-63(119)45-95-77(132)85(10,11)110-76(131)66(49(5)6)104-81(136)88(16,17)107-71(126)57(36-39-62(94)118)100-67(122)50(7)96-78(133)86(12,13)106-68(123)51(8)97-79(134)87(14,15)109-74(129)60-34-30-42-114(60)83(138)91(22,23)105-52(9)116/h26-28,31-32,47-51,54-60,65-66,115H,29-30,33-46H2,1-25H3,(H2,93,117)(H2,94,118)(H,95,132)(H,96,133)(H,97,134)(H,98,124)(H,99,119)(H,100,122)(H,101,125)(H,102,135)(H,103,128)(H,104,136)(H,105,116)(H,106,123)(H,107,126)(H,108,127)(H,109,129)(H,110,131)(H,111,130)(H,112,137)(H,120,121)/t50-,51-,54-,55-,56-,57-,58-,59-,60-,65-,66-/m0/s1

| SMILES1 = CC(C)CC(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NC(Cc2ccccc2)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C3CCCN3C(=O)C(C)(C)NC(=O)C

| InChIKey = LGHSQOCGTJHDIL-UTXLBGCNBC

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 438243

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C92H150N22O25/c1-47(2)43-58(72(127)108-92(24,25)84(139)113-41-29-33-59(113)73(128)103-65(48(3)4)75(130)111-90(20,21)82(137)112-89(18,19)80(135)102-56(37-40-64(120)121)70(125)101-55(35-38-61(93)117)69(124)98-54(46-115)44-53-31-27-26-28-32-53)99-63(119)45-95-77(132)85(10,11)110-76(131)66(49(5)6)104-81(136)88(16,17)107-71(126)57(36-39-62(94)118)100-67(122)50(7)96-78(133)86(12,13)106-68(123)51(8)97-79(134)87(14,15)109-74(129)60-34-30-42-114(60)83(138)91(22,23)105-52(9)116/h26-28,31-32,47-51,54-60,65-66,115H,29-30,33-46H2,1-25H3,(H2,93,117)(H2,94,118)(H,95,132)(H,96,133)(H,97,134)(H,98,124)(H,99,119)(H,100,122)(H,101,125)(H,102,135)(H,103,128)(H,104,136)(H,105,116)(H,106,123)(H,107,126)(H,108,127)(H,109,129)(H,110,131)(H,111,130)(H,112,137)(H,120,121)/t50-,51-,54-,55-,56-,57-,58-,59-,60-,65-,66-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LGHSQOCGTJHDIL-UTXLBGCNSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo =27061-78-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0LT1I1B7S8

| PubChem =16132042

| SMILES =CC(C)C[C@@H](C(=O)NC(C)(C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC2=CC=CC=C2)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)[C@H](C(C)C)NC(=O)C(C)(C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)[C@@H]3CCCN3C(=O)C(C)(C)NC(=O)C

}}

|Section2={{Chembox Properties

| Formula =C92H150N22O25

| MolarMass =1964.31 g/mol

| Appearance =Off white solid

| Density =

| MeltingPtC = 255 to 270

| MeltingPt_notes =

| BoilingPt =

| Solubility =Insoluble

| SolubleOther = Soluble

| Solvent = DMSO, methanol, ethanol

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Alamethicin is a channel-forming peptide antibiotic, produced by the fungus Trichoderma viride. It belongs to peptaibol peptides which contain the non-proteinogenic amino acid residue Aib (2-aminoisobutyric acid). This residue strongly induces formation of alpha-helical structure. The peptide sequence is

: Ac-Aib-Pro-Aib-Ala-Aib-Ala-Gln-Aib-Val-Aib-Gly-Leu-Aib-Pro-Val-Aib-Aib-Glu-Gln-Phl

where Ac = acetyl, Phl = phenylalaninol, and Aib = 2-Aminoisobutyric acid.

In cell membranes, it forms voltage-dependent ion channels by aggregation of four to six molecules.

Biosynthesis

Alamethicin biosynthesis is hypothesized to be catalyzed by alamethicin synthase, a Nonribosomal peptide synthase (NRPS) first isolated in 1975.{{Cite journal| doi = 10.1016/0014-5793(76)80074-9| pmid = 945191| issn = 0014-5793| volume = 62| issue = 3| pages = 276–280| last1 = Rindfleisch| first1 = H.| last2 = Kleinkauf| first2 = H.| title = Biosynthesis of alamethicin| journal = FEBS Letters| date = 1976-03-01| doi-access = free}} Although there are several sequences of the alamethicin peptide accepted,{{Cite journal| doi = 10.1002/psc.535| issn = 1075-2617| volume = 9| issue = 11–12| pages = 799–809| last1 = Kirschbaum| first1 = Jochen| last2 = Krause| first2 = Corina| last3 = Winzheimer| first3 = Ruth K.| last4 = Brückner| first4 = Hans| title = Sequences of alamethicins F30 and F50 reconsidered and reconciled| journal = Journal of Peptide Science| date = November–December 2003| pmid = 14658799| s2cid = 25076336}} evidence suggests these all follow the general NRPS mechanism {{Cite journal| doi = 10.1021/cr960029e| issn = 0009-2665| volume = 97| issue = 7| pages = 2651–2674| last1 = Marahiel| first1 = Mohamed A.| last2 = Stachelhaus| first2 = Torsten| last3 = Mootz| first3 = Henning D.| title = Modular Peptide Synthetases Involved in Nonribosomal Peptide Synthesis| journal = Chemical Reviews| date = 1997-11-01| pmid=11851476}} with small variations at select amino acids.{{Cite journal| issn = 0001-6187| volume = 22| issue = 4| pages = 411–418| last1 = Kleinkauf| first1 = H.| last2 = Rindfleisch| first2 = H.| title = Non-ribosomal biosynthesis of the cyclic octadecapeptide alamethicin| journal = Acta Microbiologica Academiae Scientiarum Hungaricae| date = 1975| pmid = 1241650}} Beginning with the acylation of the N terminal of the first aminoisobutiric acid on the ALM synthase enzyme by Acetyl-CoA,{{Cite journal| issn = 0006-3002| volume = 526| issue = 2| pages = 375–386| last1 = Mohr| first1 = H.| last2 = Kleinkauf| first2 = H.| title = Alamethicin biosynthesis: acetylation of the amino terminus and attachment of phenylalaninol| journal = Biochimica et Biophysica Acta (BBA) - Enzymology| date = 1978-10-12| pmid = 568941| doi=10.1016/0005-2744(78)90129-8}} this is followed by the sequential condensation of amino acids by each modular unit of the synthetase.{{Cite journal| doi = 10.1016/S0969-2126(00)00560-8| issn = 0969-2126| volume = 9| issue = 1| pages = –3–R9| last1 = Weber| first1 = Thomas| last2 = Marahiel| first2 = Mohamed A| title = Exploring the Domain Structure of Modular Nonribosomal Peptide Synthetases| journal = Structure| date = January 2001| pmid = 11342140| doi-access = free}} Amino acids are initially adenylated by an “adenylylation” (A) domain before being attached by a thioester bond to an Acyl Carrier Protein-like Peptidyl carrier protein.{{Cite journal| doi = 10.1021/cr0503097| issn = 0009-2665| volume = 106| issue = 8| pages = 3468–3496| last1 = Fischbach| first1 = Michael A.| last2 = Walsh| first2 = Christopher T.| title = Assembly-line enzymology for polyketide and nonribosomal Peptide antibiotics: logic, machinery, and mechanisms| journal = Chemical Reviews| date = August 2006| pmid = 16895337}} The growing chain is attached to the amino acid bearing PCP by the "condensation" (C) domain, followed by another round of the same reactions by the next module.

File:NRPS basics corrected2.jpg

Assembly is completed by the addition of phenylalaninol, an unusual amino acid-like substrate.{{Cite journal| doi = 10.1021/ma00069a031| issn = 0024-9297| volume = 26| issue = 17| pages = 4617–4623| last1 = Turner| first1 = S. Richard| last2 = Voit| first2 = Brigitte I.| last3 = Mourey| first3 = Thomas H.| title = All-aromatic hyperbranched polyesters with C-phenylalaninol and N-acetate end groups: synthesis and characterization| journal = Macromolecules| date = 1993-08-01|bibcode = 1993MaMol..26.4617T }} Following addition of phenylalaninol the completed peptide chain is cleaved by the thioesterase domain, cleaving the thioester bond and leaving an alcohol.{{cn|date=March 2023}}

File:Alamethicinbiosynth corrected2.jpg

References

{{reflist}}

Further reading

  • {{cite journal | last1 = Jones | first1 = LR | last2 = Maddock | first2 = SW | last3 = Besch | first3 = HR Jr | year = 1980 | title = Unmasking effect of alamethicin on the (Na+,K+)-ATPase, beta-adrenergic receptor-coupled adenylate cyclase, and cAMP-dependent protein kinase activities of cardiac sarcolemmal vesicles | journal = J. Biol. Chem. | volume = 255 | issue = 20| pages = 9971–9980 | doi = 10.1016/S0021-9258(18)43488-6 | pmid = 6253461 | doi-access = free }}
  • Explore structures of [http://www.ebi.ac.uk/pdbe/searchResults.html?display=both&term=NOR00010 Alamethicin] at the protein data bank
  • [http://bioinfo.lifl.fr/norine/result.jsp?ID=NOR00010 Alamethicin] in Norine
  • From "A voltage-gated ion channel model inferred from the crystal structure of alamethicin at 1.5-A resolution." {{Cite journal

| last1 = Fox Jr

| first1 = RO

| last2 = Richards

| first2 = FM

| title = A voltage-gated ion channel model inferred from the crystal structure of alamethicin at 1.5-A resolution

| journal = Nature

| volume = 300

| issue = 5890

| pages = 325–30

| year = 1982

| pmid = 6292726

|bibcode = 1982Natur.300..325F |doi = 10.1038/300325a0 | s2cid = 4278453

}}

  • {{Cite journal| doi = 10.1002/cbdv.200790095| pmid = 17589875| issn = 1612-1880| volume = 4| issue = 6| pages = 1027–1051| last1 = Leitgeb| first1 = Balázs| last2 = Szekeres| first2 = András| last3 = Manczinger| first3 = László| last4 = Vágvölgyi| first4 = Csaba| last5 = Kredics| first5 = László| title = The History of Alamethicin: A Review of the Most Extensively Studied Peptaibol| journal = Chemistry & Biodiversity| date = 2007-06-01| s2cid = 40886688}}

{{Non-ribosomally synthesized channels}}

Category:Polypeptide antibiotics

Category:Antimicrobial peptides