Alclometasone

{{short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{refimprove|date=November 2018}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477316653

| IUPAC_name = (7R,8S,9S,10R,11S,13S,14S,16R,17R)-7-Chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one

| image = Alclometasone.svg

| tradename = Aclovate

| Drugs.com = {{drugs.com|monograph|aclovate}}

| MedlinePlus = a604021

| pregnancy_US = C

| legal_US = Rx only

| routes_of_administration = Topical

| bioavailability = 3% systemically (topical)

| metabolism = Hepatic

| onset = Eczema: 5.3 - 13.9 days; Psoriasis: 6.7 - 14.8 days

{{cite web|url=https://www.drugs.com/ppa/alclometasone.html|title=Alclometasone - Professional Patient Advice|website=Drugs.com|access-date=29 December 2017}}

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 67452-97-5

| ATC_prefix = D07

| ATC_suffix = AB10

| ATC_supplemental = {{ATC|S01|BA10}}

| PubChem = 5311000

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00240

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4470541

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 136H45TB7B

| KEGG_Ref =

| KEGG =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 53776

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201361

| C=22 | H=29 | Cl=1 | O=5

| smiles = C[C@@H]1C[C@H]2[C@@H]3[C@@H](CC4=CC(=O)C=C[C@@]4([C@H]3[C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)C)Cl

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI =1S/C22H29ClO5/c1-11-6-14-18-15(23)8-12-7-13(25)4-5-20(12,2)19(18)16(26)9-21(14,3)22(11,28)17(27)10-24/h4-5,7,11,14-16,18-19,24,26,28H,6,8-10H2,1-3H3/t11-,14+,15-,16+,18-,19+,20+,21+,22+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FJXOGVLKCZQRDN-PHCHRAKRSA-N

}}

Alclometasone is a synthetic corticosteroid for topical dermatologic use, possessing anti-inflammatory, antipruritic, and vasoconstrictive properties.{{cite web|url=https://www.drugs.com/pro/alclometasone.html|title=Alclometasone - FDA Prescribing Information|website=Drugs.com|access-date=29 December 2017}}{{cite journal | vauthors = ((No authors listed)) | title = Alclometasone--another topical corticosteroid | journal = The Medical Letter on Drugs and Therapeutics | volume = 29 | issue = 738 | pages = 42–43 | date = April 1987 | pmid = 3574236 | doi = | url = }}

The prodrug alclometasone dipropionate was originally marketed under the brand name Aclovate by GlaxoSmithKline as a topical cream and ointment. However, generic versions of the drug are available.