Alifedrine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Alifedrine.png

| width = 125px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration = Oral, intravenous

| class = β-Adrenergic receptor partial agonist; Sympathomimetic

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 78756-61-3

| CAS_supplemental =

| PubChem = 51719

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 46808

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K2PM66M0VQ

| KEGG =

| ChEBI =

| ChEMBL = 2104023

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = D-13625

| IUPAC_name = 1-cyclohexyl-3-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]propan-1-one

| C=18 | H=27 | N=1 | O=2

| SMILES = C[C@@H]([C@@H](C1=CC=CC=C1)O)NCCC(=O)C2CCCCC2

| StdInChI = 1S/C18H27NO2/c1-14(18(21)16-10-6-3-7-11-16)19-13-12-17(20)15-8-4-2-5-9-15/h3,6-7,10-11,14-15,18-19,21H,2,4-5,8-9,12-13H2,1H3/t14-,18-/m0/s1

| StdInChIKey = UEELVIXXTBPOCF-KSSFIOAISA-N

}}

Alifedrine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name D-13625) is a drug described as a sympathomimetic and cardiotonic or positive inotropic agent which was never marketed.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA28 | access-date=29 August 2024 | page=1-PA373}}{{cite book | vauthors = Morton IK, Hall JM | title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms | publisher=Springer Netherlands | year=1999 | isbn=978-0-7514-0499-9 | url=https://books.google.com/books?id=mqaOMOtk61IC&pg=PA10 | access-date=29 August 2024 | page=10}}{{cite book | title=Pharmaceutical Manufacturing Encyclopedia | publisher=Elsevier Science | series=Volumes 1-4 | year=2013 | isbn=978-0-8155-1856-3 | url=https://books.google.com/books?id=_J2ti4EkYpkC&pg=PA155 | access-date=2024-08-29 | page=155}}{{cite journal | vauthors = Wainwright CL, Parratt JR | title = Alifedrine, a positive inotropic agent that moderately reduces the severity of ischaemia and reperfusion-induced ventricular arrhythmias | journal = European Journal of Pharmacology | volume = 147 | issue = 3 | pages = 373–380 | date = March 1988 | pmid = 3378563 | doi = 10.1016/0014-2999(88)90171-9 }} It is a β-adrenergic receptor partial agonist and was studied in the treatment of heart failure.{{cite journal | vauthors = Wan SK, Hoff W, Evans TR | title = Haemodynamic effects of intravenous and oral alifedrine in patients with cardiac failure | journal = Current Medical Research and Opinion | volume = 11 | issue = 4 | pages = 242–253 | date = 1988 | pmid = 3215041 | doi = 10.1185/03007998809114243 }}{{cite journal | vauthors = Anand IS, Hughes LO, Whittington JR, Raftery EB | title = Acute haemodynamic effects of different doses of alifedrine in congestive heart failure | journal = European Journal of Clinical Pharmacology | volume = 36 | issue = 4 | pages = 335–341 | date = 1989 | pmid = 2737225 | doi = 10.1007/BF00558291 }}{{cite journal | vauthors = Metzenauer P, Dedecke R, Göbel H, Martorana PA, Stroman F, Szelenyi I | title = Effects of the novel beta-adrenergic partial agonist alifedrine on cardiac performance in dogs with acute ischemic left ventricular failure | journal = Journal of Cardiovascular Pharmacology | volume = 14 | issue = 1 | pages = 103–108 | date = July 1989 | pmid = 2475700 | doi = 10.1097/00005344-198907000-00018 | s2cid = 72099344 | doi-access = free }} The drug is taken by mouth or intravenously. It is a β-hydroxylated substituted amphetamine derivative.{{cite web | title=Alifedrine | work = PubChem | publisher = U.S. National Library of Medicine | url=https://pubchem.ncbi.nlm.nih.gov/compound/51719 | access-date=29 August 2024}}

See also

References