Allixin
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477317800
| ImageFile = Allixin.svg
| ImageSize = 200px
| PIN = 3-Hydroxy-5-methoxy-6-methyl-2-pentyl-4H-pyran-4-one
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 125263-70-9
| CASNo_Ref = {{cascite|changed|CAS}}
| PubChem = 86374
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 77892
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 851A356OPF
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H18O4/c1-4-5-6-7-9-10(13)11(14)12(15-3)8(2)16-9/h13H,4-7H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OHRPDNHRQKOLGN-UHFFFAOYSA-N
| SMILES = O=C1C(/OC)=C(\O/C(=C1/O)CCCCC)C
| InChI = InChI=1S/C12H18O4/c1-4-5-6-7-9-10(13)11(14)12(15-3)8(2)16-9/h13H,4-7H2,1-3H3
}}
|Section2={{Chembox Properties
| C=12 | H=18 | O=4
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Allixin is a phytoalexin found in garlic (Allium sativum) bulbs. It was first isolated and characterized in 1989.{{cite journal | author = Kodera, Yukihiro | author2 = Matsuura, Hiromichi | author3 = Yoshida, Susumu | author4 = Sumida, Toshihiko | author5 = Itakura, Yoichi | author6 = Fuwa, Toru | author7 = Nishino, Hoyoku | title = Allixin, a stress compound from garlic | journal = Chemical & Pharmaceutical Bulletin | year = 1989 | volume = 37 | issue = 6 | pages = 1656–1658|doi=10.1248/cpb.37.1656| doi-access = free }} When garlic is stored for long periods of time, it can form visible accumulations of crystalline allixin on its surface, particularly in areas where tissue has become necrotic.{{cite journal | doi = 10.1248/cpb.50.405 | last1 = Kodera | first1 = Y | last2 = Ayabe | first2 = M | last3 = Ogasawara | first3 = K | last4 = Yoshida | first4 = S | last5 = Hayashi | first5 = N | last6 = Ono | first6 = K | title = Allixin Accumulation with Long-term Storage of Garlic | journal = Chemical & Pharmaceutical Bulletin | volume = 50 | issue = 3 | pages = 405–7 | year = 2002 | pmid= 11911208| doi-access = free }} After 2 years of storage, the amount of allixin accumulated can approach 1% of the dry weight of the cloves. Since allixin has weak antimicrobial activity, these high concentrations are thought to be produced by the garlic bulb to protect itself from further damage from microorganisms.
Since allixin is found in high concentrations in garlic, there has been scientific interest in determining if it is responsible for any of the known health benefits of garlic. As a result of ongoing research, a variety of biological activities have been attributed to allixin. Pharmaceutical drug discovery research based on derivatives of allixin has followed.{{cite journal | last1 = Hiromura | first1 = Makoto | last2 = Sakurai | first2 = Hiromu | title = Action mechanism of metallo-allixin complexes as antidiabetic agents | journal = Pure and Applied Chemistry | volume = 80 | pages = 2727–2733 | year = 2008 | issue = 12 | doi = 10.1351/pac200880122727| doi-access = free }}
Laboratory synthesis
Two laboratory syntheses of allixin have been developed. In the first method, reported in 1997, allixin was synthesized in 22 steps starting from D-mannose.{{cite journal | last1 = Arimoto | first1 = H | title = Total synthesis of allixin; an anti-tumor promoter from garlic | journal = Tetrahedron Letters | volume = 38 | pages = 7761–7762 | year = 1997 | issue = 44 | doi = 10.1016/S0040-4039(97)10072-7}} A shorter synthesis was developed in 1998 which involved only 5 steps, starting from 5-methylfurfural.{{cite journal | last1 =Matsumura | first1 =Y | title =Facile Synthesis of Allixin and Its Related Compounds | journal =Tetrahedron Letters | volume =39 | pages =2339–2340 | year =1998 | issue =16 | doi =10.1016/S0040-4039(98)00148-8}}
Biological activities
In in vitro studies, allixin demonstrates neurotrophic activity, but at high concentrations it has cytotoxic effects.{{cite journal | last1 =Moriguchi | first1 =T | last2 =Matsuura | first2 =H | last3 =Itakura | first3 =Y | last4 =Katsuki | first4 =H | last5 =Saito | first5 =H | last6 =Nishiyama | first6 =N | title =Allixin, a phytoalexin produced by garlic, and its analogues as novel exogenous substances with neurotrophic activity | journal =Life Sciences | volume =61 | issue =14 | pages =1413–20 | year =1997 | pmid =9335231 | doi =10.1016/S0024-3205(97)00687-5}} Simple chemical analogs of allixin were found to have more potent neurotrophic activity, but without the cytotoxic effects. Allixin may therefore be a useful starting point for the development of pharmaceutical drugs for the treatment of neurodegenerative disorders or for neuronal regeneration in the brain.
Pharmacological studies have demonstrated that allixin exerts an anti-promoting activity against skin tumors induced by the chemical 12-O-tetradecanoylphorbol-13-acetate (TPA){{cite journal |author1=Nishino, H. |author2=Nishino, A. |author3=Takayasu, J. |author4=Iwashima, A. |author5=Itakura, Y. |author6=Kodera, Y. |author7=Matsuura, H. |author8=Fuwa, T. | title = Antitumor-promoting activity of allixin, a stress compound produced by garlic | journal = Cancer Journal | year = 1990 | volume = 3 | issue = 1 | pages = 20–21}} and an inhibitory effect on aflatoxin B1-induced mutagenesis.{{cite journal | last1 = Yamasaki | first1 = T. | last2 = Teel | first2 = R.W. | last3 = Lau | first3 = B.H.S. | title = Effect of allixin, a phytoalexin produced by garlic, on mutagenesis, DNA-binding and metabolism of aflatoxin B1 | journal = Cancer Letters | volume = 59 | issue = 2 | pages = 89–94 | year = 1991 | pmid = 1909211 | doi = 10.1016/0304-3835(91)90171-D }} Allixin may therefore be responsible, at least in part, for the tumor-preventative effects of garlic extract.{{cite journal | doi = 10.1038/bjc.1993.82 |vauthors=Dorant E, van den Brandt PA, Goldbohm RA, Hermus RJ, Sturmans F | title = Garlic and its significance for the prevention of cancer in humans: a critical view | journal = British Journal of Cancer | year = 1993 | volume = 67 | issue = 3 | pages = 424–429 | pmid = 8439494 | pmc = 1968250}}{{cite journal | doi = 10.1002/(SICI)1098-1128(199601)16:1<111::AID-MED4>3.0.CO;2-5 | author = Agarwal, Kailash C. | title = Therapeutic actions of garlic constituents | journal = Medicinal Research Reviews | year = 1996 | volume = 16 | issue = 1 | pages = 111–124 | pmid = 8788216| s2cid = 20891167 }}
Allixin has also been shown to have a radical scavenging effect.{{cite journal | doi = 10.1055/s-2006-959522 |author1=Imai, J. |author2=Ide, N. |author3=Nagae, S. |author4=Moriguchi, T. |author5=Matsuura, H. |author6=Itakura, Y. | title = Antioxidant and radical scavenging effects of aged garlic extract and its constituents | journal = Planta Medica | year = 1994 | volume = 60 | issue = 5 | pages = 417–420 | pmid = 7997468|s2cid=44533555 }}
Metal complexes
Metal complexes with allixin have been shown to have beneficial pharmacological effects in animal models of diabetes. A complex with vanadium, bis(allixinato)oxovanadium(IV), is a potent anti-diabetic agent. In studies in streptozotocin-induced diabetic mice, this vanadium complex was shown to be an insulin mimetic with hypoglycemic effects.{{cite journal | last1 = Adachi | first1 = Yusuke | last2 = Yoshida | first2 = Jiro | last3 = Kodera | first3 = Yukihiro | last4 = Katoh | first4 = Akira | last5 = Takada | first5 = Jitsuya | last6 = Sakurai | first6 = Hiromu | title = Bis(allixinato)oxovanadium(IV) Complex Is a Potent Antidiabetic Agent: Studies on Structure−Activity Relationship for a Series of Hydroxypyrone−Vanadium Complexes | journal = Journal of Medicinal Chemistry | volume = 49 | issue = 11 | pages = 3251–6 | year = 2006 | pmid = 16722643 | doi = 10.1021/jm060229a}} Similarly, a zinc-allixin complex, bis(allixinato)zinc(II), shows the same insulin mimetic effects.{{Cite journal | last1 = Adachi | first1 = Yusuke | last2 = Yoshida | first2 = Jiro | last3 = Kodera | first3 = Yukihiro | last4 = Kato | first4 = Akira | last5 = Yoshikawa | first5 = Yutaka | last6 = Kojima | first6 = Yoshitane | last7 = Sakurai | first7 = Hiromu | title = A new insulin-mimetic bis(allixinato)zinc(II) complex: structure?activity relationship of zinc(II) complexes | journal = Journal of Biological Inorganic Chemistry | volume = 9 | pages = 885–893 | year = 2004 | issue = 7 | doi = 10.1007/s00775-004-0590-8| pmid = 15378407 | s2cid = 11210678 }}{{Cite journal | last1 = Adachi | first1 = Yusuke | last2 = Yoshida | first2 = Jiro | last3 = Kodera | first3 = Yukihiro | last4 = Sakurai | first4 = Hiromu | title = A Highly Potent Insulin–mimetic Zinc(II) Complex with a Zn(S2O2) Coordination Mode: Bis(1,6-dimethyl-3-hydroxy-5-methoxy-2-pentyl-1,4-dihydropyridine-4-thionato)zinc(II) | journal = Chemistry Letters | volume = 34 | pages = 656–657 | year = 2005 | issue = 5 | doi = 10.1246/cl.2005.656}} The mechanism of action by which these complexes regulate insulin signaling pathways is unclear.
File: VO(alx)2.svg| Bis(allixinato)oxovanadium(IV)
File:Zn(alx)2.svg| Bis(allixinato)zinc(II)