Allobarbital

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 477317940

| IUPAC_name = 5,5-di(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione

| image = Allobarbital.svg

| image_class = skin-invert-image

| width = 120

| image2 = Allobarbital ball-and-stick animation.gif

| width2 = 160

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_BR = B1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule IV

| legal_UK =

| legal_US = Schedule III

| legal_DE = Anlage III

| legal_status =

| routes_of_administration =

| class = Barbiturate

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 52-43-7

| ATC_prefix = N05

| ATC_suffix = CA21

| PubChem = 5842

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5635

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8NT43GG2HA

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02817

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 267719

| C=10 | H=12

| N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(C\C=C)C\C=C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H12N2O3/c1-3-5-10(6-4-2)7(13)11-9(15)12-8(10)14/h3-4H,1-2,5-6H2,(H2,11,12,13,14,15)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FDQGNLOWMMVRQL-UHFFFAOYSA-N

| synonyms = 5,5-Diallylbarbituric acid, Diallylmalonylurea

}}

Allobarbital, also known as allobarbitone and branded as Dial, Cibalgine (in combination with aminophenazone), or Dial-Ciba (in combination with ethyl carbamate), is a barbiturate derivative invented in 1912 by Ernst Preiswerk and Ernst Grether working for CIBA. It was used primarily as an anticonvulsant{{cite journal | vauthors = Chocholová L, Radil-Weiss T | title = Effect of allobarbital on focal epilepsy in rats | journal = Physiologia Bohemoslovaca | volume = 20 | issue = 4 | pages = 325–34 | year = 1971 | pmid = 4335127 }} although it has now largely been replaced by newer drugs with improved safety profiles. Other uses for allobarbital included as an adjutant to boost the activity of analgesic drugs, and use in the treatment of insomnia and anxiety.

Allobarbital was never particularly widely used compared to better known barbiturates such as phenobarbital and secobarbital, although it saw more use in some European countries such as Bulgaria and Slovakia.{{cite journal | vauthors = Getova D, Georgiev V | title = GABA-ergic mechanisms in the anticonvulsive activity of newly-synthesized barbiturates. I. Effects of barbiturates on the convulsive action of GABA-antagonists | journal = Acta Physiologica et Pharmacologica Bulgarica | volume = 13 | issue = 3 | pages = 43–50 | year = 1987 | pmid = 3439474 }} In Poland, it was used until the 2010's, but only as compound.{{cite web|title=APTECZKA BABUNI - KROPLE ŻOŁĄDKOWE KROPLE 20 G |trans-title=GRANDMA'S FIRST AID KIT - DROPS - STOMACH DROPS 20 G |website=Domzdrowia.pl |language=Polish |url=http://www.domzdrowia.pl/29439,apteczka-babuni-krople-zoladkowe-krople-20-g.html |archive-url=https://web.archive.org/web/20071031195035/http://www.domzdrowia.pl/29439%2Capteczka-babuni-krople-zoladkowe-krople-20-g.html |archive-date=October 31, 2007 |access-date=March 10, 2013 |url-status=live }}

References

{{reflist}}

{{Hypnotics and sedatives}}

{{GABAAR PAMs}}

Category:Barbiturates

Category:Allyl compounds