Almestrone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (7R,8R,9S,13S,14S)-3-hydroxy-7,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one

| image = Almestrone.svg

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Estrogen

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 10448-96-1

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 65601

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 59042

| ChEMBL = 2104052

| UNII = N18A31MTB0

| synonyms = Ba 38372; Ciba 38372; 7α-Methylestrone

| C=19 | H=24 | O=2

| SMILES = CC1CC2=C(C=CC(=C2)O)C3C1C4CCC(=O)C4(CC3)C

| StdInChI_Ref =

| StdInChI = InChI=1S/C19H24O2/c1-11-9-12-10-13(20)3-4-14(12)15-7-8-19(2)16(18(11)15)5-6-17(19)21/h3-4,10-11,15-16,18,20H,5-9H2,1-2H3/t11-,15-,16+,18-,19+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = JUAJXSMWFOFDFC-MNHDCVOLSA-N

}}

Almestrone ({{abbrlink|INN|International Nonproprietary Name}}) (developmental code names Ba 38372, Ciba 38372), also known as 7α-methylestrone, is a synthetic, steroidal estrogen which was synthesized in 1967 but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA900|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=900–}} It is used as a precursor in the synthesis of several highly active steroids.{{cite book| vauthors = Krause N, Aksin-Artok Ö |title=PATai's Chemistry of Functional Groups|chapter=Copper-Mediated and Copper-Catalyzed Addition and Substitution Reactions of Extended Multiple Bond Systems|year=2011|doi=10.1002/9780470682531.pat0450|isbn=9780470682531}}{{cite journal| vauthors = Morais GR, Yoshioka N, Watanabe M, Mataka S, Oliveira CD, Thiemann T |title=C7-Substituted Estranes and Related Steroids|journal=Mini-Reviews in Organic Chemistry|volume=3|issue=3|year=2006|pages=229–251|issn=1570-193X|doi=10.2174/1570193X10603030229}}