Alprenolol

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 443660388

| IUPAC_name = (RS)-1-(2-allylphenoxy)-3-(isopropylamino)propan-2-ol

| image = Alprenolol2.svg

| tradename =

| Drugs.com = {{drugs.com|international|alprenolol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| protein_bound = 80% - 90%

| metabolism =

| elimination_half-life = 2-3 hours → 4-OH-alprenolol

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 13655-52-2

| ATC_prefix = C07

| ATC_suffix = AA01

| ATC_supplemental =

| PubChem = 2119

| IUPHAR_ligand = 563

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00866

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2035

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 877K5MQ27W

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07156

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 51211

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 266195

| chemical_formula =

| C=15 | H=23

| N=1 | O=2

| smiles = O(c1ccccc1C\C=C)CC(O)CNC(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PAZJSJFMUHDSTF-UHFFFAOYSA-N

}}

Alprenolol, or alfeprol, alpheprol, and alprenololum (Gubernal, Regletin, Yobir, Apllobal, Aptine, Aptol Duriles), is a non-selective beta blocker as well as a 5-HT1A and 5-HT1B receptor antagonist,{{cite journal | vauthors = Langlois M, Brémont B, Rousselle D, Gaudy F | title = Structural analysis by the comparative molecular field analysis method of the affinity of beta-adrenoreceptor blocking agents for 5-HT1A and 5-HT1B receptors | journal = Eur. J. Pharmacol. | volume = 244 | issue = 1 | pages = 77–87 | year = 1993 | pmid = 8093601 | doi = 10.1016/0922-4106(93)90061-d}} used in the treatment of angina pectoris.{{cite journal|author=Hickie JB|date=1970|title=Alprenolol ("aptin") in angina pectoris. A double-blind multicentre trial|journal=Med. J. Aust.|volume=2|issue=6|pages=268–72|doi=10.5694/j.1326-5377.1970.tb49984.x|pmid=4393977|s2cid=6879318}} It is no longer marketed by AstraZeneca, but may still be available from other pharmaceutical companies or generically.

References

{{Reflist|2}}

{{Beta blockers}}

{{Adrenergic receptor modulators}}

{{Serotonin receptor modulators}}

Category:5-HT1A antagonists

Category:5-HT1B antagonists

Category:N-isopropyl-phenoxypropanolamines

Category:Drugs developed by AstraZeneca

Category:Allyl compounds

Category:Beta blockers

{{Amine-stub}}

{{Cardiovascular-drug-stub}}