Alprenolol
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 443660388
| IUPAC_name = (RS)-1-(2-allylphenoxy)-3-(isopropylamino)propan-2-ol
| image = Alprenolol2.svg
| tradename =
| Drugs.com = {{drugs.com|international|alprenolol}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Oral
| bioavailability =
| protein_bound = 80% - 90%
| metabolism =
| elimination_half-life = 2-3 hours → 4-OH-alprenolol
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 13655-52-2
| ATC_prefix = C07
| ATC_suffix = AA01
| ATC_supplemental =
| PubChem = 2119
| IUPHAR_ligand = 563
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00866
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2035
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 877K5MQ27W
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07156
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 51211
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 266195
| chemical_formula =
| C=15 | H=23
| N=1 | O=2
| smiles = O(c1ccccc1C\C=C)CC(O)CNC(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PAZJSJFMUHDSTF-UHFFFAOYSA-N
}}
Alprenolol, or alfeprol, alpheprol, and alprenololum (Gubernal, Regletin, Yobir, Apllobal, Aptine, Aptol Duriles), is a non-selective beta blocker as well as a 5-HT1A and 5-HT1B receptor antagonist,{{cite journal | vauthors = Langlois M, Brémont B, Rousselle D, Gaudy F | title = Structural analysis by the comparative molecular field analysis method of the affinity of beta-adrenoreceptor blocking agents for 5-HT1A and 5-HT1B receptors | journal = Eur. J. Pharmacol. | volume = 244 | issue = 1 | pages = 77–87 | year = 1993 | pmid = 8093601 | doi = 10.1016/0922-4106(93)90061-d}} used in the treatment of angina pectoris.{{cite journal|author=Hickie JB|date=1970|title=Alprenolol ("aptin") in angina pectoris. A double-blind multicentre trial|journal=Med. J. Aust.|volume=2|issue=6|pages=268–72|doi=10.5694/j.1326-5377.1970.tb49984.x|pmid=4393977|s2cid=6879318}} It is no longer marketed by AstraZeneca, but may still be available from other pharmaceutical companies or generically.
References
{{Reflist|2}}
{{Beta blockers}}
{{Adrenergic receptor modulators}}
{{Serotonin receptor modulators}}
Category:N-isopropyl-phenoxypropanolamines
Category:Drugs developed by AstraZeneca
{{Amine-stub}}
{{Cardiovascular-drug-stub}}