Altrose
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 457807456
| ImageFile = Altrose linear.png
| ImageSize = 244
| ImageName = Stereo structural formula of (5R)-altrose
| ImageFile1 = Altrose.png
| ImageSize1 = 244
| ImageName1 = Stereo structural formula of (6R)-altropyranose
| IUPACName = altro-Hexosehttps://iupac.qmul.ac.uk/2carb/app.html
| PIN = Altrose
| SystematicName = (2S,3R,4R)-2,3,4,5,6-Pentahydroxyhexanal
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 389851
| InChI = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5+,6?/m1/s1
| InChIKey1 = WQZGKKKJIJFFOK-RSVSWTKNSA-N
| SMILES1 = O[C@@H]1[C@H](O)[C@H](OC(O)[C@H]1O)CO
| InChI1 = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5+,6?/m1/s1
| CASNo = 1990-29-0
| CASNo_Comment = (D)
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 1949-88-8
| CASNo1_Comment = (L)
| CASNo1_Ref = {{cascite|correct|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5PLN1O36FF
| UNII_Comment = (D)
| PubChem = 441032
| PubChem_Comment = (D)
| PubChem1 = 10219674
| PubChem1_Comment = (L)
| ChEBI = 28385
| ChEBI_Comment = (D)
| ChEBI1 = 63421
| ChEBI1_Comment = (L)
| KEGG = C06464
| KEGG_Comment = (D)
| SMILES = OCC(O)[C@@H](O)[C@@H](O)[C@H](O)C=O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4?,5+,6-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GZCGUPFRVQAUEE-ZPQYLTHOSA-N}}
| Section2 = {{Chembox Properties
| C = 6
| H = 12
| O = 6
| MeltingPtC = 103 to 105}}
}}
Altrose is an aldohexose sugar. D-Altrose is an unnatural monosaccharide. It is soluble in water and practically insoluble in methanol. However, L-altrose has been isolated from strains of the bacterium Butyrivibrio fibrisolvens.{{Ref patent |country=US |number=4966845 |title=Microbial production of L-altrose |invent1=Stack; Robert J. |status= patent |gdate=1990-10-30 |assign1=Government of the United States of America, Secretary of Agriculture |class= }}
Altrose is a C-3 epimer of mannose. The ring conformation of α-altropyranoside is flexible compared to most other aldohexopyranosides, with idose as exception. In solution different derivatives of altrose have been shown to occupy both 4C1, OS2 and 1C4-conformations.{{cite journal|last1=Immel|first1=Stefan|last2=Fujita|first2=Kahee|last3=Lichtenthaler|first3=Frieder W.|title=Solution Geometries and Lipophilicity Patterns ofα-Cycloaltrin|journal=Chemistry - A European Journal|volume=5|issue=11|year=1999|pages=3185–3192|issn=0947-6539|doi=10.1002/(SICI)1521-3765(19991105)5:11<3185::AID-CHEM3185>3.0.CO;2-W}}
File:D-Altrose Haworth.svgs of various forms of D-altrose]]{{clear left}}
References
{{reflist}}
{{Carbohydrates}}
{{Ether-stub}}