Amenamevir

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| IUPAC_name = N-(2,6-Dimethylphenyl)-N-[2-[4-(1,2,4-oxadiazol-3-yl)anilino]-2-oxoethyl]-1,1-dioxothiane-4-carboxamide

| image = Amenamevir.svg

| width = 200px

| caption =

| pronounce =

| tradename = Amenalief

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status = Rx-only

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 841301-32-4

| class =

| ATCvet =

| ATC_prefix = J05

| ATC_suffix = AX26

| PubChem = 11397521

| ChemSpiderID = 9572421

| UNII = 94X46KW4AE

| DrugBank = 11701

| KEGG = D10564

| synonyms = ASP-2151, ASP2151

| C=24|H=26|N=4|O=5|S=1

| StdInChI=1S/C24H26N4O5S/c1-16-4-3-5-17(2)22(16)28(24(30)19-10-12-34(31,32)13-11-19)14-21(29)26-20-8-6-18(7-9-20)23-25-15-33-27-23/h3-9,15,19H,10-14H2,1-2H3,(H,26,29)

| StdInChIKey=MNHNIVNAFBSLLX-UHFFFAOYSA-N

| smiles = Cc1cccc(C)c1N(CC(=O)Nc1ccc(-c2ncon2)cc1)C(=O)C1CCS(=O)(=O)CC1

}}

Amenamevir (trade name Amenalief) is an antiviral drug used for the treatment of shingles (herpes zoster).

It acts as an inhibitor of the zoster virus's helicase–primase complex.{{cite journal | vauthors = Kawashima M, Nemoto O, Honda M, Watanabe D, Nakayama J, Imafuku S, Kato T, Katsuramaki T | display-authors = 6 | title = Amenamevir, a novel helicase-primase inhibitor, for treatment of herpes zoster: A randomized, double-blind, valaciclovir-controlled phase 3 study | journal = The Journal of Dermatology | volume = 44 | issue = 11 | pages = 1219–1227 | date = November 2017 | pmid = 28681394 | pmc = 5697646 | doi = 10.1111/1346-8138.13948 }}{{cite journal | vauthors = Yajima M, Yamada H, Takemoto M, Daikoku T, Yoshida Y, Long T, Okuda T, Shiraki K | s2cid = 43813287 | display-authors = 6 | title = Profile of anti-herpetic action of ASP2151 (amenamevir) as a helicase-primase inhibitor | journal = Antiviral Research | volume = 139 | pages = 95–101 | date = March 2017 | pmid = 28027917 | doi = 10.1016/j.antiviral.2016.12.008 }} Amenamevir was approved in Japan for the treatment of shingles in 2017.{{Cite press release | url = http://www.evaluategroup.com/Universal/View.aspx?type=Story&id=720058 | title = Maruho Receives Manufacturing and Marketing Approval for Anti-Herpes Virus Agent "Amenalief® Tab. 200mg" in Japan | date = July 3, 2017 | publisher = evaluategroup.com}}