Amidephrine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443383199

| image = Amidephrine.svg

| width = 250px

| tradename = Dricol, Fentrinol, Nalde

| pregnancy_category =

| legal_status =

| class =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 37571-84-9

| CAS_supplemental =
1421-68-7 (mesylate)

| ATC_prefix = None

| ATC_suffix =

| PubChem = 15010

| IUPHAR_ligand = 514

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 14288

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7E2P22546V

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 146408

| DrugBank = DB16623

| synonyms = Amidefrine; MJ-1996; MJ-5190; 3-Methylsulfonamidyl-β-hydroxy-N-methylphenethylamine; 3-Methylsulfonamidyl-β-hydroxy-N-methyl-β-phenylethylamine

| IUPAC_name = (RS)-N-{3-[1-hydroxy-2-(methylamino)ethyl]phenyl}methanesulfonamide

| C=10 | H=16 | N=2 | O=3 | S=1

| SMILES = O=S(=O)(Nc1cc(ccc1)C(O)CNC)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H16N2O3S/c1-11-7-10(13)8-4-3-5-9(6-8)12-16(2,14)15/h3-6,10-13H,7H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZHOWHMXTJFZXRB-UHFFFAOYSA-N

}}

Amidephrine ({{Abbrlink|BAN|British Approved Name}}), or amidefrine, sold under the brand name Fentrinol among others, is a selective α₁-adrenergic receptor agonist which is described as an adrenergic or sympathomimetic, vasoconstrictor, and topical nasal decongestant used to treat allergic rhinitis.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA40 | access-date=2024-08-31 | page=40}}{{cite book | vauthors = Morton IK, Hall JM | title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms | publisher=Springer Netherlands | year=2012 | isbn=978-94-011-4439-1 | url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA13 | access-date=2024-08-31 | page=13}}{{cite book | author=Schweizerischer Apotheker-Verein | title=Index Nominum 2000: International Drug Directory | publisher=Medpharm Scientific Publishers | year=2000 | isbn=978-3-88763-075-1 | url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA39 | access-date=2024-08-31 | page=39}}{{cite web | title=Amidephrine: Uses, Interactions, Mechanism of Action | website=DrugBank Online | date=24 February 2021 | url=https://go.drugbank.com/drugs/DB16623 | access-date=31 August 2024}}{{cite journal | vauthors = MacLean MR, Thomson M, Hiley CR | title = Pressor effects of the alpha 2-adrenoceptor agonist B-HT 933 in anaesthetized and haemorrhagic rats: comparison with the haemodynamic effects of amidephrine | journal = British Journal of Pharmacology | volume = 97 | issue = 2 | pages = 419–432 | date = June 1989 | pmid = 2569342 | pmc = 1854522 | doi = 10.1111/j.1476-5381.1989.tb11969.x }} It is used as the mesylate salt, which has the generic names amidefrine mesilate ({{Abbrlink|INN|International Nonproprietary Name}}) and amidephrine mesylate ({{Abbrlink|USAN|United States Adopted Name}}). The drug is a substituted phenethylamine derivative and is also known as 3-methylsulfonamidyl-β-hydroxy-N-methylphenethylamine.{{cite web | title=Amidephrine | work = PubChem | publisher = U.S. National Library of Medicine | url=https://pubchem.ncbi.nlm.nih.gov/compound/15010 | access-date=31 August 2024}} As of 2000, it remained marketed only in Austria.