Ammonium hexafluorophosphate

{{chembox

| Watchedfields = changed

| verifiedrevid = 399519634

| ImageFile = ammonium hexafluorophosphate.png

| ImageFileL1 = Ammonium-3D-balls.png

| ImageNameL1 = Ball-and-stick model of the ammonium cation

| ImageFileR1 = Hexafluorophosphate-3D-balls.png

| ImageNameR1 = Ball-and-stick model of the hexafluorophosphate anion

| IUPACName=ammonium hexafluorophosphate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7969679

| EC_number = 241-009-1

| UNII = NS308031PJ

| InChI = 1/F6P.H3N/c1-7(2,3,4,5)6;/h;1H3/q-1;/p+1

| InChIKey = NIZXKAYXSNUDOU-IKLDFBCSAF

| SMILES1 = F[P-](F)(F)(F)(F)F.[NH4+]

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/F6P.H3N/c1-7(2,3,4,5)6;/h;1H3/q-1;/p+1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NIZXKAYXSNUDOU-UHFFFAOYSA-O

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=16941-11-0

| PubChem=9793912

| SMILES=[NH4+].F[P-](F)(F)(F)(F)F

}}

|Section2={{Chembox Properties

| Formula=(NH₄)[PF₆]

| MolarMass=163.00264

| Appearance= white solid

| Density=2.180 g/cm³

| Solubility=74.8 g/100 mL(20 °C)

}}

|Section3={{Chembox Hazards

| ExternalSDS = [http://msds.chem.ox.ac.uk/AM/ammonium_hexafluorophosphate.html Oxford MSDS]

| GHSPictograms = {{GHS05}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|314}}

| PPhrases = {{P-phrases|260|264|280|301+330+331|303+361+353|304+340|305+351+338|310|321|363|405|501}}

}}

}}

Ammonium hexafluorophosphate is the inorganic compound with the formula NH₄PF₆. It is a white water-soluble, hygroscopic solid. The compound is a salt consisting of the ammonium cation and hexafluorophosphate anion. It is commonly used as a source of the hexafluorophosphate anion, a weakly coordinating anion. It is prepared by combining neat ammonium fluoride and phosphorus pentachloride. Alternatively it can also be produced from phosphonitrilic chloride:{{cite book|author=W. Kwasnik|chapter=Ammonium Hexafluorophosphate (V)|title=Handbook of Preparative Inorganic Chemistry, 2nd Ed. |editor=G. Brauer|publisher=Academic Press|year=1963|place=NY, NY|volume=1|pages=195–196}}

:PCl₅ + 6 NH₄F → NH₄PF₆ + 5 NH₄Cl

:PNCl₂ + 6 HF → NH₄PF₆ + 2 HCl