Ammonium hexafluorotitanate

{{Chembox

| ImageFile = (NH4)2TiF6.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 16962-40-6

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChemSpiderID = 9496500

| EC_number = 241-036-9

| PubChem = 11321546

| SMILES = [NH4+].[NH4+].F[Ti-2](F)(F)(F)(F)F

| StdInChI=1S/6FH.2H3N.Ti/h6*1H;2*1H3;/q;;;;;;;;+4/p-4

| StdInChIKey=NMGYKLMMQCTUGI-UHFFFAOYSA-J

}}

| Section2 = {{Chembox Properties

| H=8 | Ti=1 | F=6|N = 2

| MolarMass =

| Appearance = white solid

| Density = 1.675g/cm3

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

| Section8 = {{Chembox Related

| OtherAnions = Hexafluorosilicate
Hexafluorotitanic acid

}}

}}

Ammonium hexafluorotitanate is the inorganic compound with the chemical formula (NH4)2[TiF6]. A colorless salt, the compound consists of ammonium ions and the hexafluorotitanate dianion.

Synthesis

The compound is encountered in the extraction of titanium from its principal ore ilmenite: the ore is treated with excess ammonium fluoride:{{cite book |doi=10.1002/9780470132364.ch22|chapter=Extraction of Titanium(IV) Oxide from Ilmenite |year=1957 |last1=Bichowsky |first1=Foord Von |title=Inorganic Syntheses |pages=79–82 |isbn=9780470132364|volume=V }}

::{{chem2|FeTiO3 + 10 NH4F -> (NH4)2FeF4 + (NH4)2TiF6 + 6 H2O}}

After removal of iron impurities, the titanium is recovered as a hydrated titanium dioxide by treatment of the aqueous extract of the hexafluoride with ammonia:

::{{chem2|(NH4)2TiF6 + 4 NH3 + 2 H2O -> TiO2 + 6 NH4F}}

Structure

Many salts of hexafluorotitanate have been characterized by X-ray crystallography. In the lattice [TiF6]2- octahedra interact with the ammonium cations by hydrogen bonds.{{cite journal |doi=10.1107/S0567740882007195|title=Hydrogen bonding in Diammonium Hexafluorotitanate |year=1982 |last1=Tun |first1=Z. |last2=Brown |first2=I. D. |journal=Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry |volume=38 |issue=6 |pages=1792–1794 |bibcode=1982AcCrB..38.1792T }}

References

{{Inorganic-compound-stub}}

{{fluorine compounds}}

{{titanium compounds}}

Category:Fluorine compounds

Category:Titanium(IV) compounds

Category:Fluorometallates