Ammonium hexafluorozirconate
{{Chembox
| Name = Ammonium hexafluorozirconate
| ImageFile1 =
| ImageSize1 = 200px
| ImageFile2 =
| ImageSize2 = 200px
| IUPACName =
| PIN =
| OtherNames = Diammonium hexafluorozirconate(2-), diammonium hexafluorozirconate, bis(ammonium) hexafluorozirconate(2-)
|Section1={{Chembox Identifiers
| CASNo = 16919-31-6
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 11221763
| ChEBI =
| EINECS = 240-970-4
| Gmelin =
| PubChem = 46173004
| SMILES = [NH4+].[NH4+].F[Zr-2](F)(F)(F)(F)F
| StdInChI= 1S/6FH.2H3N.Zr/ h6*1H;2*1H3;/q;;;;;;;;+4/p-4
| StdInChIKey = LPFRXGDQGULMEN-UHFFFAOYSA-J
}}
|Section2={{Chembox Properties
| H=8 | Zr=1 | F=6 | N= 2
| Appearance = White Powder
| Density = 1.15 g/cm3
| MeltingPtC =
| BoilingPtC =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS07}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{HPhrases|301|311|314|315|317|319|331|335|372|412}}
| PPhrases = {{PPhrases|260|261|262|264|264+265|270|271|272|273|280|301+316|301+330+331|302+352|302+361+354|304+340|305+351+338|305+354+338|316|317|319|321|330|332+317|333+317|337+317|361+364|362+364|363|403+233|405|501 }}
}}
|Section6={{Chembox Related
| OtherCompounds =
}}
}}
Ammonium hexafluorozirconate is a complex inorganic compound of nitrogen, hydrogen, fluorine, and zirconium with the chemical formula {{chem2|(NH4)2ZrF6}}.{{cite web |title=Ammonium Hexafluorozirconate |url=https://www.americanelements.com/ammonium-hexafluorozirconate-16919-31-6 |publisher=American Elements}}{{cite book |last1=Haynes |first1=William M. |title=CRC Handbook of Chemistry and Physics |date=2016 |publisher=CRC Press |isbn=9781439880500 |page=4-47 |url=https://books.google.com/books?id=c1rNBQAAQBAJ&dq=Ammonium+hexafluorozirconate&pg=SA4-PA47 |access-date=27 February 2024}}{{cite book |last1=Chadwick |first1=John C. |last2=Severn |first2=John R. |publisher=Wiley |isbn=9783527621675 |page=178 |url=https://books.google.com/books?id=rCQHK0ht0TgC&dq=Ammonium+hexafluorozirconate&pg=PA178 |access-date=27 February 2024|title=Tailor-Made Polymers: Via Immobilization of Alpha-Olefin Polymerization Catalysts|date=25 June 2008 }}
Uses
Ammonium hexafluorozirconate is used in anticorrosion treatment of metals; it forms ultrafine metal powder by thermal decomposition. It is also used as an additive in dental impression materials.{{cite book |last1=Daniel |first1=F. M. |last2=Macintyre |first2=Jane Elizabeth |last3=Stirling |first3=V. M. |title=Dictionary of Inorganic Compounds Volume 1 |date=1992 |publisher=Chapman & Hall |page=3239 |isbn=978-0-412-30120-9 |url=https://books.google.com/books?id=9eJvoNCSCRMC&dq=Ammonium+hexafluorozirconate&pg=PA3239 |access-date=27 February 2024}}
References
{{Reflist}}
{{Zirconium compounds}}
{{Fluorine compounds}}