Ammonium hexafluorozirconate

{{Chembox

| Name = Ammonium hexafluorozirconate

| ImageFile1 =

| ImageSize1 = 200px

| ImageFile2 =

| ImageSize2 = 200px

| IUPACName =

| PIN =

| OtherNames = Diammonium hexafluorozirconate(2-), diammonium hexafluorozirconate, bis(ammonium) hexafluorozirconate(2-)

|Section1={{Chembox Identifiers

| CASNo = 16919-31-6

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 11221763

| ChEBI =

| EINECS = 240-970-4

| Gmelin =

| PubChem = 46173004

| SMILES = [NH4+].[NH4+].F[Zr-2](F)(F)(F)(F)F

| StdInChI= 1S/6FH.2H3N.Zr/ h6*1H;2*1H3;/q;;;;;;;;+4/p-4

| StdInChIKey = LPFRXGDQGULMEN-UHFFFAOYSA-J

}}

|Section2={{Chembox Properties

| H=8 | Zr=1 | F=6 | N= 2

| Appearance = White Powder

| Density = 1.15 g/cm³

| MeltingPtC =

| BoilingPtC =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| GHS_ref = {{cite web |title=Ammonium hexafluorozirconate |url=https://pubchem.ncbi.nlm.nih.gov/compound/46173004#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS07}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{HPhrases|301|311|314|315|317|319|331|335|372|412}}

| PPhrases = {{PPhrases|260|261|262|264|264+265|270|271|272|273|280|301+316|301+330+331|302+352|302+361+354|304+340|305+351+338|305+354+338|316|317|319|321|330|332+317|333+317|337+317|361+364|362+364|363|403+233|405|501 }}

}}

|Section6={{Chembox Related

| OtherCompounds =

}}

}}

Ammonium hexafluorozirconate is a complex inorganic compound of nitrogen, hydrogen, fluorine, and zirconium with the chemical formula {{chem2|(NH4)2ZrF6}}.{{cite web |title=Ammonium Hexafluorozirconate |url=https://www.americanelements.com/ammonium-hexafluorozirconate-16919-31-6 |publisher=American Elements}}{{cite book |last1=Haynes |first1=William M. |title=CRC Handbook of Chemistry and Physics |date=2016 |publisher=CRC Press |isbn=9781439880500 |page=4-47 |url=https://books.google.com/books?id=c1rNBQAAQBAJ&dq=Ammonium+hexafluorozirconate&pg=SA4-PA47 |access-date=27 February 2024}}{{cite book |last1=Chadwick |first1=John C. |last2=Severn |first2=John R. |publisher=Wiley |isbn=9783527621675 |page=178 |url=https://books.google.com/books?id=rCQHK0ht0TgC&dq=Ammonium+hexafluorozirconate&pg=PA178 |access-date=27 February 2024|title=Tailor-Made Polymers: Via Immobilization of Alpha-Olefin Polymerization Catalysts|date=25 June 2008 }}