Ampelopsin A

{{chembox

| Name = Ampelopsin A

| ImageFile = Ampelopsin A.svg

| ImageSize = 200px

| ImageCaption = (+)-Ampelopsin A

| ImageName = Chemical structure of (+)-ampelopsin A

| ImageAlt = Chemical structure of ampelopsin A

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| index1_label = (-)

| index2_label = (+)

| CASNo1 = 280561-81-1

| CASNo2 = 130608-11-6

| CASNo_Ref =

| ChemSpiderID1 = 25051387

| ChemSpiderID2= 24651694

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII1 = S86WX55WAF

| ChemSpiderID =

| PubChem2 = 182999

| ChEMBL1 = 1224886

| ChEMBL2 = 601296

| SMILES = Oc1ccc(cc1)C6c2c(cc(O)cc2O)C3c5c(cc(O)cc5OC3c4ccc(O)cc4)C6O

| InChI=1S/C28H22O7/c29-15-5-1-13(2-6-15)23-24-19(9-17(31)11-21(24)33)26-25-20(27(23)34)10-18(32)12-22(25)35-28(26)14-3-7-16(30)8-4-14/h1-12,23,26-34H/t23-,26-,27-,28+/m0/s1

| InChIKey = LHUHHURKGTUZHU-QWMXJGQVSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C = 28 | H = 22 | O = 7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Ampelopsin A is a resveratrol dimer found in Ampelopsis glandulosa var. hancei (formerly A. brevipedunculata var. hancei).