Ampelopsin B

{{Chembox

| ImageFile = Ampelopsin B.svg

| ImageSize = 200px

| IUPACName = (1S,7S,11bS)-1,7-Bis(4-hydroxyphenyl)-1,6,7,11b-tetrahydro-2-oxadibenzo[cd,h]azulene-4,8,10-triol

| OtherNames = (+)-Ampelopsin B
(−)-Ampelopsin B

|Section1={{Chembox Identifiers

| CASNo = 130518-19-3

| CASNo_Ref = {{cascite|correct|}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BX77KJ8J5L

| PubChem = 5318088

| ChemSpiderID = 4476716

| ChEBI = 76191

| SMILES = Oc1ccc(cc1)[C@H]6c2c(cc(O)cc2O)[C@H]4c5c(cc(O)cc5O[C@@H]4c3ccc(O)cc3)C6

| InChI = 1/C28H22O6/c29-17-5-1-14(2-6-17)21-10-16-9-19(31)13-24-25(16)27(22-11-20(32)12-23(33)26(21)22)28(34-24)15-3-7-18(30)8-4-15/h1-9,11-13,21,27-33H,10H2/t21-,27-,28+/m0/s1

| InChIKey = JJCVXDDMIRXVJA-YNOBPPCABK

| StdInChI = 1S/C28H22O6/c29-17-5-1-14(2-6-17)21-10-16-9-19(31)13-24-25(16)27(22-11-20(32)12-23(33)26(21)22)28(34-24)15-3-7-18(30)8-4-15/h1-9,11-13,21,27-33H,10H2/t21-,27-,28+/m0/s1

| StdInChIKey = JJCVXDDMIRXVJA-YNOBPPCASA-N

}}

|Section2={{Chembox Properties

| C=28 | H=22 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Ampelopsin B is a stilbenoid dimer found in Ampelopsis glandulosa var. hancei (formerly Ampelopsis brevipedunculata var. hancei).{{cite journal | doi = 10.1016/S0040-4020(01)87819-4 | title = Ampelopsins A, B and C, new oligostilbenes of Ampelopsis brevipedunculata var hancei | year = 1990 | last1 = Oshima | first1 = Y | journal = Tetrahedron | volume = 46 | issue = 15 | pages = 5121}}Chemical determination of the absolute structures of resveratrol dimers, ampelopsins A, B, D and F. Yoshiaki Takaya, Ke-Xu Yan, Kenji Terashima, Junko Ito and Masatake Niwa, Tetrahedron, 2002, 58, pages 7259–7265, {{doi|10.1016/S0040-4020(02)00785-8}}