Anacetrapib

{{chembox

| Verifiedfields = changed

| verifiedrevid = 444391072

| ImageFile = Anacetrapib.svg

| ImageSize = 200px

| PIN = (4S,5R)-5-[3,5-Bis(trifluoromethyl)phenyl]-3-{[4′-fluoro-2′-methoxy-5′-(propan-2-yl)-4-(trifluoromethyl)[1,1′-biphenyl]-2-yl]methyl}-4-methyl-1,3-oxazolidin-2-one

| OtherNames = MK-0859

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 9731205

| InChI = 1/C30H25F10NO3/c1-14(2)22-11-23(25(43-4)12-24(22)31)21-6-5-18(28(32,33)34)9-17(21)13-41-15(3)26(44-27(41)42)16-7-19(29(35,36)37)10-20(8-16)30(38,39)40/h5-12,14-15,26H,13H2,1-4H3/t15-,26-/m0/s1

| InChIKey = MZZLGJHLQGUVPN-HAWMADMCBN

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C30H25F10NO3/c1-14(2)22-11-23(25(43-4)12-24(22)31)21-6-5-18(28(32,33)34)9-17(21)13-41-15(3)26(44-27(41)42)16-7-19(29(35,36)37)10-20(8-16)30(38,39)40/h5-12,14-15,26H,13H2,1-4H3/t15-,26-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MZZLGJHLQGUVPN-HAWMADMCSA-N

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P7T269PR6S

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 875446-37-0

| PubChem = 11556427

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1800807

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08855

| SMILES = O=C2O[C@H](c1cc(cc(c1)C(F)(F)F)C(F)(F)F)[C@@H](N2Cc4c(c3cc(c(F)cc3OC)C(C)C)ccc(c4)C(F)(F)F)C

}}

|Section2={{Chembox Properties

| Formula = C₃₀H₂₅F₁₀NO₃

| MolarMass = 637.51 g·mol⁻¹

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Anacetrapib is a CETP inhibitor which was being developed to treat elevated cholesterol levels in an effort to prevent cardiovascular disease.

{{cite journal

|vauthors =Gutstein DE, Krishna R, Johns D

|title=Anacetrapib, a Novel CETP Inhibitor: Pursuing a New Approach to Cardiovascular Risk Reduction

|journal=Clinical Pharmacology & Therapeutics

|volume=91 |issue=1 |pages=109–122

|year=2012

|doi=10.1038/clpt.2011.271

|pmid=22130116

|s2cid=36510986

|url=http://www.nature.com/clpt/journal/v91/n1/full/clpt2011271a.html

| display-authors=etal|url-access=subscription

}} In 2017 its development was abandoned by Merck.{{cite news|title=Merck says will not seek approval of cholesterol treatment|url=https://www.reuters.com/article/us-merck-cholesterol/merck-says-will-not-seek-approval-of-cholesterol-treatment-idUSKBN1CG2W1|accessdate=18 October 2017|work=Reuters|date=2017}}