Androsterone sulfate

{{Chembox

| ImageFile = Androsterone sulfate.svg

| ImageSize =

| ImageAlt =

| IUPACName = 17-Oxo-5α-androstan-7α-yl hydrogen sulfate

| SystematicName = (3aS,3bR,5aS,9aS,9bS,11aS)-9a,11a-Dimethyl-1-oxohexadecahydro-1H-cyclopenta[a]phenanthren-7-yl hydrogen sulfate

| OtherNames = 3α-Hydroxy-5α-androstan-17-one 3-sulfate; 5α-Androstane-3α-ol-17-one 3-sulfate

| Section1 = {{Chembox Identifiers

| CASNo = 2479-86-9

| ChEBI = 83037

| ChEMBL = 2074598

| ChemSpiderID = 140383

| InChI = 1S/C19H30O5S/c1-18-9-7-13(24-25(21,22)23)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h12-16H,3-11H2,1-2H3,(H,21,22,23)/t12-,13+,14-,15-,16-,18-,19-/m0/s1

| InChIKey = ZMITXKRGXGRMKS-HLUDHZFRSA-N

| PubChem = 159663

| SMILES = C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)OS(=O)(=O)O

| UNII = UK5M12Z93J

}}

| Section2 = {{Chembox Properties

| C=19 | H=30 | O=5 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Androsterone sulfate, also known as 3α-hydroxy-5α-androstan-17-one 3α-sulfate, is an endogenous, naturally occurring steroid and one of the major urinary metabolites of androgens.{{cite journal | vauthors = Mueller JW, Gilligan LC, Idkowiak J, Arlt W, Foster PA | title = The Regulation of Steroid Action by Sulfation and Desulfation | journal = Endocr. Rev. | volume = 36 | issue = 5 | pages = 526–63 | year = 2015 | pmid = 26213785 | pmc = 4591525 | doi = 10.1210/er.2015-1036 }}{{Cite web|url=http://www.hmdb.ca/metabolites/HMDB02759|title = Human Metabolome Database: Showing metabocard for Androsterone sulfate (HMDB0002759)}} It is a steroid sulfate which is formed from sulfation of androsterone by the steroid sulfotransferase SULT2A1 and can be desulfated back into androsterone by steroid sulfatase.