Angiotensinamide
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| verifiedrevid = 459715971
| IUPAC_name = 2-[(1-
| image = Angiotensinamide.svg
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration = Intravenous infusion
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 53-73-6
| ATC_prefix = C01
| ATC_suffix = CX06
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7WAL1X78KV
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02939
| ChEMBL = 409803
| PubChem = 10351092
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8526544
| smiles = O=C(N)C[C@H](N)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)CCC2)Cc3cnc[nH]3)C(C)C)Cc4ccc(O)cc4)C(C)C)CCC/N=C(\N)N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C49H70N14O11/c1-26(2)39(61-42(67)33(12-8-18-55-49(52)53)57-41(66)32(50)23-38(51)65)45(70)58-34(20-29-14-16-31(64)17-15-29)43(68)62-40(27(3)4)46(71)59-35(22-30-24-54-25-56-30)47(72)63-19-9-13-37(63)44(69)60-36(48(73)74)21-28-10-6-5-7-11-28/h5-7,10-11,14-17,24-27,32-37,39-40,64H,8-9,12-13,18-23,50H2,1-4H3,(H2,51,65)(H,54,56)(H,57,66)(H,58,70)(H,59,71)(H,60,69)(H,61,67)(H,62,68)(H,73,74)(H4,52,53,55)/t32-,33-,34-,35-,36-,37-,39-,40-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JYPVVOOBQVVUQV-CGHBYZBKSA-N
| C=49 | H=70
| N=14 | O=11
}}
Angiotensinamide (INN; BAN and USAN angiotensin amide) is a potent vasoconstrictor used as a cardiac stimulant.{{cite journal | vauthors = Paiva TB, Paiva AC | title = Some pharmacological actions of synthetic analogues of angiotensinamide | journal = British Journal of Pharmacology and Chemotherapy | volume = 15 | issue = 4 | pages = 557–560 | date = December 1960 | pmid = 13732133 | pmc = 1482268 | doi = 10.1111/j.1476-5381.1960.tb00281.x }} It is a derivative of angiotensin II.{{cite book |title=Index nominum, international drug directory = internationales Arzneistoff-und Arzneimittelverzeichnis = répertoire international des substances médicamenteuses et spécialités pharmaceutiques |date=2000 |publisher=Medpharm Scientific Publishers |location=Stuttgart |isbn=978-3-88763-075-1 |edition=17th | page = 64 | chapter = Angiotensinamide | chapter-url = https://books.google.com/books?id=5GpcTQD_L2oC&dq=Angiotensinamide&pg=PA64}}