Antrocamphin B

{{Chembox

| ImageFile = Antrocamphin B.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 4-(3,4,6-Trimethoxy-2-methylphenyl)but-3-yn-2-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 945622-08-2

| CASNo_Ref = {{Cascite|changed|}}{{cite web |title=KNApSAcK Metabolite Information - C00038468 |url=http://www.knapsackfamily.com/knapsack_core/information.php?word=C00038468 |website=www.knapsackfamily.com}}

| ChEMBL = 229342

| PubChem = 16737473

| ChemSpiderID = 20568908

| InChI=1S/C14H16O4/c1-9(15)6-7-11-10(2)14(18-5)13(17-4)8-12(11)16-3/h8H,1-5H3

| InChIKey= IKGSJDIGQRJKDN-UHFFFAOYSA-N

| SMILES = CC1=C(C(=CC(=C1OC)OC)OC)C#CC(=O)C}}

|Section2={{Chembox Properties

| C=14 | H=16 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Antrocamphin B is an unusual chemical compound isolated from Taiwanofungus camphoratus.{{cite journal|pmid=24385001 | doi=10.1039/c3ob42333f | volume=12 | issue=7 | title=Ethynylbenzenoid metabolites of Antrodia camphorata: synthesis and inhibition of TNF expression | date=February 2014 | journal=Org. Biomol. Chem. | pages=1100–13 |vauthors=Buccini M, Punch KA, Kaskow B |display-authors=etal|url=http://pubs.rsc.org/en/content/articlepdf/2014/ob/c3ob42333f | doi-access=free }} Antrocamphin B is a congener of antrocamphin A.{{cite journal|vauthors=Buccini M, Punch KA, Kaskow B, Flematti GR, Skelton BW, Abraham LJ | title=Ethynylbenzenoid metabolites of Antrodia camphorata: synthesis and inhibition of TNF expression. | journal=Org Biomol Chem | year= 2014 | volume= 12 | issue= 7 | pages= 1100–13 | pmid=24385001 | doi=10.1039/c3ob42333f |display-authors=etal| doi-access=free }}