Arbaclofen placarbil

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid =

| IUPAC_name = (3R)-3-(4-chlorophenyl)-4-[[[(1S)-2-methyl-1-[(2-methylpropanoyl)oxy]propoxy]carbonyl]amino]butanoic acid

| image = Arbaclofen placarbil.svg

| width = 260

| tradename =

| Drugs.com =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category = N/A

| legal_AU =

| legal_UK =

| legal_US =

| legal_status = Development terminated

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 847353-30-4

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| ChEMBL = 2107312

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| PubChem = 11281011

| ChemSpiderID = 9456008

| smiles = CC(C)C(=O)O[C@@H](OC(=O)NC[C@H](CC(=O)O)c1ccc(Cl)cc1)C(C)C

| StdInChI = 1S/C19H26ClNO6/c1-11(2)17(24)26-18(12(3)4)27-19(25)21-10-14(9-16(22)23)13-5-7-15(20)8-6-13/h5-8,11-12,14,18H,9-10H2,1-4H3,(H,21,25)(H,22,23)/t14-,18-/m0/s1

| StdInChIKey = JXTAALBWJQJLGN-KSSFIOAISA-N

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W89H91R7VX

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08861

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| C=19 | H=26

| Cl=1 | N=1

| O=6

}}

Arbaclofen placarbil ({{IPAc-en|ɑːr|ˈ|b|æ|k|l|oʊ|f|ɛ|n|_|p|l|ə|ˈ|k|ɑːr|b|ɪ|l}} {{respell|ar|BAK|loh|fen|_|plə|KAR|bil}}, also known as XP19986) is a prodrug of R-baclofen. Arbaclofen placarbil possesses more favorable pharmacokinetic profile than baclofen, with less fluctuations in plasma drug levels. It was being developed as a potential treatment for patients with GERD and spasticity due to multiple sclerosis; however, in May 2013 XenoPort announced the termination of development because of unsuccessful results in phase III clinical trials.{{Cite web |url=http://investor.xenoport.com/releasedetail.cfm?ReleaseID=765868 |title=XenoPort Reports Top-Line Results of Phase 3 Trial of Arbaclofen Placarbil for Spasticity in Multiple Sclerosis Patients | date = May 20, 2013 | work = XenoPort, Inc. |access-date=2013-06-03 |archive-url= https://web.archive.org/web/20131202021940/http://investor.xenoport.com/releasedetail.cfm?ReleaseID=765868 |archive-date=2013-12-02 |url-status=usurped }}

It is being developed as an addiction medicine to treat alcoholism. {{Cite web | vauthors = Anderson E | date = 3 July 2020 | work = The i newspaper | publisher = Associated Newspapers Limited. | url=https://inews.co.uk/essentials/news/business/pill-replaces-alcohol-aims-end-middle-class-drinking-epidemic/ |title = Pill that replaces alcohol aims to end 'glass of wine' craving}} It is also studied as a potential therapeutic for some autistic subjects.{{cite journal | vauthors = Huang Q, Pereira AC, Velthuis H, Wong NM, Ellis CL, Ponteduro FM, Dimitrov M, Kowalewski L, Lythgoe DJ, Rotaru D, Edden RA, Leonard A, Ivin G, Ahmad J, Pretzsch CM, Daly E, Murphy DG, McAlonan GM | display-authors = 6 | title = GABA_B receptor modulation of visual sensory processing in adults with and without autism spectrum disorder | journal = Science Translational Medicine | volume = 14 | issue = 626 | pages = eabg7859 | date = January 2022 | pmid = 34985973 | doi = 10.1126/scitranslmed.abg7859 | s2cid = 245771626 | url = http://gala.gre.ac.uk/id/eprint/38031/7/38031_AHMAD_GABAB_receptor_modulation_of_visual_sensory_processing.pdf }}