Arbutamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457138752

| IUPAC_name = 4-[(1R)-1-hydroxy-2-{[4-(4-hydroxyphenyl)butyl]amino}ethyl]benzene-1,2-diol

| image = Arbutamine.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 128470-16-6

| ATC_prefix = C01

| ATC_suffix = CA22

| PubChem = 60789

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01102

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 54785

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = B07L15YAEV

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 50580

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201251

| C=18 | H=23 | N=1 | O=4

| smiles = Oc1ccc(cc1O)[C@@H](O)CNCCCCc2ccc(O)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H23NO4/c20-15-7-4-13(5-8-15)3-1-2-10-19-12-18(23)14-6-9-16(21)17(22)11-14/h4-9,11,18-23H,1-3,10,12H2/t18-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = IIRWWTKISYTTBL-SFHVURJKSA-N

}}

Arbutamine is a cardiac stimulant. It stimulates β adrenergic receptors.{{cite journal | vauthors = Abou-Mohamed G, Nagarajan R, Ibrahim TM, Caldwell RW | title = Characterization of the adrenergic activity of arbutamine, a novel agent for pharmacological stress testing | journal = Cardiovascular Drugs and Therapy | volume = 10 | issue = 1 | pages = 39–47 | date = March 1996 | pmid = 8723169 | doi = 10.1007/BF00051129 | s2cid = 30315981 }}