Artemisin
{{Short description|Chemical compound}}
{{distinguish|Artemisinin}}
{{Chembox
| ImageFile = Artemisin.svg
| ImageSize = 150px
| ImageAlt =
| PIN = (3S,3aR,4S,5aS,9bS)-4-Hydroxy-3,5a,9-trimethyl-3a,5,5a,9b-tetrahydronaphtho[1,2-b]furan-2,8(3H,4H)-dione
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 481-05-0
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEBI = 2852
| ChEMBL = 158124
| ChemSpiderID = 58542
| KEGG = C09344
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y1R67R7XWU
| PubChem = 65030
| SMILES = C=1C(=O)C(C)=C2[C@@](C1)(C[C@@H]([C@H]1[C@@H](C(O[C@H]21)=O)C)O)C
| InChI = 1S/C15H18O4/c1-7-9(16)4-5-15(3)6-10(17)11-8(2)14(18)19-13(11)12(7)15/h4-5,8,10-11,13,17H,6H2,1-3H3/t8-,10-,11+,13-,15+/m0/s1
| StdInChIKey = LUHMMHZLDLBAKX-DBIGVJDZSA-N
}}
| Section2 = {{Chembox Properties
| C = 15
| H = 18
| O = 4
| MolarMass =
| Appearance =
| Density =
| MeltingPtC = 203
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Artemisin is a sesquiterpene lactone, similar in structure to α-santonin.{{cite journal |last1=SUMI |first1=Masao |title=The Structure of Artemisin |journal=Proceedings of the Japan Academy |date=1956 |volume=32 |issue=9 |pages=684–687 |doi=10.2183/pjab1945.32.684|doi-access=free }}{{cite book |last1=ApSimon |first1=John |title=The Total Synthesis of Natural Products |date=2009 |publisher=John Wiley & Sons |isbn=9780470129517 |url=https://books.google.com/books?id=MhEDN-d1Dw8C&pg=PA324 |language=en}}
See also
- Artemisia (genus), hardy herbaceous plants and shrubs known for the powerful chemical constituents in their essential oils
- Artemisinin, a group of drugs used against malaria
- Santonin, an anthelminthic, drug expelling parasitic worms (helminths) by paralyzing them
References
{{Reflist}}
External links
- {{Commonscatinline}}
Category:Sesquiterpene lactones
Category:Heterocyclic compounds with 3 rings
{{Organic-compound-stub}}