Asimilobine

{{Chembox

| ImageFile = Asimilobine.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName = 1-Methoxy-12-nor-6aβ-aporphin-2-ol

| SystematicName = (6aS)-1-Methoxy-5,6,6a,7-tetrahydro-4H-benzo[i]perimidin-2-ol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 6871-21-2

| CASNo_Ref = {{cite web |title=KNApSAcK Metabolite Information - C00025231 |url=http://www.knapsackfamily.com/knapsack_core/information.php?word=C00025231 |website=www.knapsackfamily.com}}{{Cascite|changed|}}

| PubChem = 25774982

| ChemSpiderID = 23282723

| ChEMBL = 389271

| InChI = 1/C17H17NO2/c1-20-17-14(19)9-11-6-7-18-13-8-10-4-2-3-5-12(10)16(17)15(11)13/h2-5,9,13,18-19H,6-8H2,1H3/t13-/m0/s1

| InChIKey = NBDNEUOVIJYCGZ-ZDUSSCGKBL

| StdInChI = 1S/C17H17NO2/c1-20-17-14(19)9-11-6-7-18-13-8-10-4-2-3-5-12(10)16(17)15(11)13/h2-5,9,13,18-19H,6-8H2,1H3/t13-/m0/s1

| StdInChIKey = NBDNEUOVIJYCGZ-ZDUSSCGKSA-N

| SMILES = COC1=C(C=C2CCN[C@@H]3C2=C1C4=CC=CC=C4C3)O}}

|Section2={{Chembox Properties

| C=17 | H=17 | N=1 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Asimilobine is an inhibitor of dopamine biosynthesis, and a serotonergic receptor antagonist.{{cite journal | pmid = 3430176 | year = 1987 | last1 = Shoji | first1 = N | last2 = Umeyama | first2 = A | last3 = Saito | first3 = N | last4 = Iuchi | first4 = A | last5 = Takemoto | first5 = T | last6 = Kajiwara | first6 = A | last7 = Ohizumi | first7 = Y | title = Asimilobine and lirinidine, serotonergic receptor antagonists, from Nelumbo nucifera | volume = 50 | issue = 4 | pages = 773–4 | journal = Journal of Natural Products | doi=10.1021/np50052a044}}{{cite journal | pmid = 18696327 | year = 2008 | last1 = Jin | first1 = CM | last2 = Lee | first2 = JJ | last3 = Kim | first3 = YK | last4 = Ryu | first4 = SY | last5 = Lim | first5 = SC | last6 = Hwang | first6 = BY | last7 = Lee | first7 = CK | last8 = Lee | first8 = MK | title = Effects of asimilobine on dopamine biosynthesis and l-DOPA-induced cytotoxicity in PC12 cells | volume = 10 | issue = 7–8 | pages = 747–55 | doi = 10.1080/10286020802030892 | journal = Journal of Asian Natural Products Research | s2cid = 47473525 }}