Asulam

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460319166

| ImageFile = Asulam.png

| ImageSize = 240

| ImageAlt = Skeletal formula

| ImageFile1 = Asulam-3D-balls.png

| ImageSize1 = 240

| ImageAlt1 = Ball-and-stick model

| PIN = Methyl (4-aminobenzene-1-sulfonyl)carbamate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 3337-71-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0Y5ASM7P5S

| PubChem = 18752

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18350

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 17707

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 81696

| SMILES = O=S(=O)(c1ccc(N)cc1)NC(=O)OC

| InChI = 1/C8H10N2O4S/c1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7/h2-5H,9H2,1H3,(H,10,11)

| InChIKey = VGPYEHKOIGNJKV-UHFFFAOYAJ

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H10N2O4S/c1-14-8(11)10-15(12,13)7-4-2-6(9)3-5-7/h2-5H,9H2,1H3,(H,10,11)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VGPYEHKOIGNJKV-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula = C₈H₁₀N₂O₄S

| MolarMass = 230.241 g/mol

| Appearance =

| Density = 1.419 g/mL

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Asulam is a herbicide invented by May & Baker Ltd, internally called M&B9057,{{cite web|url=http://www.chemspider.com/Chemical-Structure.17707.html?rid=5a4054d2-3aa3-4364-942b-6e3bfa42cd9c|title=ChemSpider – Asulam – C8H10N2O4S|accessdate=30 September 2011}} that is used in horticulture and agriculture to kill bracken{{cite journal

| title = An assessment of aerially applied asulam as a method of long-term bracken control

| author = R. J. Pakemana, M. G. Le Ducb and R. H. Marrs

| journal = Journal of Environmental Management

| volume = 53

| issue = 3

| pages = 255–262

| year = 1998

| url =

| doi = 10.1006/jema.1998.0207 | bibcode = 1998JEnvM..53..255P

}}{{cite journal

| title = Restoration of Calluna heathland on a bracken Pteridium-infested site in north west England

| author = C. S. R. Snow and R. H. Marrs

| journal = Biological Conservation

| volume = 81

| issue = 1–2

| pages = 35–42

| year = 1997

| url =

| doi = 10.1016/S0006-3207(96)00147-4| bibcode = 1997BCons..81...35S

}} and docks.{{cite journal

| title = Interactions Between the Chrysomelid Beetle Gastrophysa viridula, the Weed Rumex obtusifolius and the Herbicide Asulam

| author = R. I. Speight and J. B. Whittaker

| journal = The Journal of Applied Ecology

| volume = 24

| issue = 1

| pages = 119–129

| year = 1987

| doi = 10.2307/2403791

| jstor = 2403791

| bibcode = 1987JApEc..24..119S

}} It is also used as an antiviral agent. It is currently marketed, by United Phosphorus Ltd - UPL, as "Asulox" which contains 400 g/L of asulam sodium salt.