Asunaprevir

{{Short description|Compound}}

{{Use dmy dates|date=November 2023}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Asunaprevir.svg

| width =

| alt =

| caption =

| image2 =

| width2 =

| alt2 =

| caption2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| captionLR =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix = J05

| ATC_suffix = AP06

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 630420-16-5

| CAS_supplemental =

| PubChem = 16076883

| PubChemSubstance =

| IUPHAR_ligand = 10882

| DrugBank = DB11586

| ChemSpiderID = 17235944

| UNII = S9X0KRJ00S

| KEGG = D10093

| ChEBI = 134723

| ChEMBL = 2105735

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = BMS-650032

| IUPAC_name = tert-butyl N-[(2S)-1-[(2S,4R)-4-(7-chloro-4-methoxyisoquinolin-1-yl)oxy-2-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate

| C=35 | H=46 | Cl=1 | N=5 | O=9 | S=1

| molecular_weight =

| SMILES = CC(C)(C)[C@@H](C(=O)N1C[C@@H](C[C@H]1C(=O)N[C@@]2(C[C@H]2C=C)C(=O)NS(=O)(=O)C3CC3)OC4=NC=C(C5=C4C=C(C=C5)Cl)OC)NC(=O)OC(C)(C)C

| Jmol =

| StdInChI = InChI=1S/C35H46ClN5O9S/c1-9-19-16-35(19,31(44)40-51(46,47)22-11-12-22)39-28(42)25-15-21(49-29-24-14-20(36)10-13-23(24)26(48-8)17-37-29)18-41(25)30(43)27(33(2,3)4)38-32(45)50-34(5,6)7/h9-10,13-14,17,19,21-22,25,27H,1,11-12,15-16,18H2,2-8H3,(H,38,45)(H,39,42)(H,40,44)/t19-,21-,25+,27-,35-/m1/s1

| StdInChI_comment =

| StdInChIKey = XRWSZZJLZRKHHD-WVWIJVSJSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Asunaprevir (formerly BMS-650032, brand name in Japan and Russia{{cite web|title=Sunvepra (asunaprevir) soft gelatin capsules 100 mg. Registration certificate|url=http://grls.rosminzdrav.ru/Grls_View_v2.aspx?idReg=374742&t=|website=State Register of Medicines|accessdate=26 August 2015|language=Russian}} Sunvepra) is an experimental drug candidate for the treatment of hepatitis C. It was undergoing development by Bristol-Myers Squibb and has completed Phase III clinical trials in 2013.{{cite web | url = http://clinicaltrials.gov/ct2/show/NCT01497834 | title = A Phase 3 Study in Combination With BMS-790052 and BMS-650032 in Japanese Hepatitis C Virus (HCV) Patients | date = 23 September 2015 | publisher = ClinicalTrials.gov}}

Asunaprevir is an inhibitor of the hepatitis C virus enzyme serine protease NS3.{{cite journal | title = Asunaprevir. HCV serine protein NS3 inhibitor, Treatment of hepatitis C virus | author = C. Reviriego | journal = Drugs of the Future | year = 2012 | volume = 37 | issue = 4 | pages = 247–254 | doi = 10.1358/dof.2012.037.04.1789350| url = https://journals.prous.com/journals/servlet/xmlxsl/pk_journals.xml_summary_pr?p_JournalId=2&p_RefId=1789350&p_IsPs=N}} Asunaprevir is being tested in combination with pegylated interferon and ribavirin, as well as in interferon-free regimens with other direct-acting antiviral agents including daclatasvir.{{cite journal | vauthors = Lok AS, Gardiner DF, Lawitz E, Martorell C, Everson GT, Ghalib R, Reindollar R, Rustgi V, McPhee F, Wind-Rotolo M, Persson A, Zhu K, Dimitrova DI, Eley T, Guo T, Grasela DM, Pasquinelli C | title = Preliminary study of two antiviral agents for hepatitis C genotype 1 | journal = The New England Journal of Medicine | volume = 366 | issue = 3 | pages = 216–24 | date = January 2012 | pmid = 22256805 | doi = 10.1056/NEJMoa1104430 | doi-access = free }}{{cite web | url = https://www.bloomberg.com/news/2012-04-19/bristol-myers-daclatasvir-asunaprevir-cured-77-study.html | title = Bristol-Myers' Daclatasvir, Asunaprevir Cured 77%: Study | publisher = Bloomberg | date = Apr 19, 2012}}[http://www.hivandhepatitis.com/hepatitis-c/hepatitis-c-topics/hcv-treatment/3337-aasld-daclatasvir-plus-asunaprevir-rapidly-suppresses-hcv-in-prior-null-responders AASLD: Daclatasvir plus Asunaprevir Rapidly Suppresses HCV in Prior Null Responders] {{Webarchive|url=https://web.archive.org/web/20150208163151/http://www.hivandhepatitis.com/hepatitis-c/hepatitis-c-topics/hcv-treatment/3337-aasld-daclatasvir-plus-asunaprevir-rapidly-suppresses-hcv-in-prior-null-responders |date=2015-02-08 }}. Highleyman, L. HIVandHepatitis.com. 8 November 2011.