Azamulin

{{Infobox drug

| IUPAC_name = (1S,2R,3S,4R,6R,7R,8R,14R)-4-Ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxotricyclo[5.4.3.0^1,8]tetradec-6-yl [(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetate

| image = Azamulin skeletal.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration =

| legal_AU =

| legal_AU_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 76530-44-4

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 16072188

| DrugBank =

| ChemSpiderID = 17231671

| UNII = 875AQ866X1

| ChEMBL = 2103760

| C=24 | H=38 | N=4 | O=4 | S=1

| molecular_weight =

| smiles = CC[C@@]1(C[C@H]([C@@]2([C@@H](CC[C@@]3([C@H]2C(=O)CC3)[C@H]([C@@H]1O)C)C)C)OC(=O)CSc4nc([nH]n4)N)C

| StdInChI=1S/C24H38N4O4S/c1-6-22(4)11-16(32-17(30)12-33-21-26-20(25)27-28-21)23(5)13(2)7-9-24(14(3)19(22)31)10-8-15(29)18(23)24/h13-14,16,18-19,31H,6-12H2,1-5H3,(H3,25,26,27,28)/t13-,14+,16-,18+,19+,22-,23+,24+/m1/s1

| StdInChIKey = FMHQJXGMLMSMLC-WBUYAQKGSA-N

}}

Azamulin is a pleuromutilin antibiotic. {{as of|2021}}, it is not marketed in the US or Europe.{{cn|date=March 2023}}

In pharmacological studies, the substance is used as an inhibitor of the liver enzymes CYP3A4 and CYP3A5.

References

{{reflist|refs=

{{cite journal | vauthors = Stresser DM, Broudy MI, Ho T, Cargill CE, Blanchard AP, Sharma R, Dandeneau AA, Goodwin JJ, Turner SD, Erve JC, Patten CJ, Dehal SS, Crespi CL | display-authors = 6 | title = Highly selective inhibition of human CYP3Aa in vitro by azamulin and evidence that inhibition is irreversible | journal = Drug Metabolism and Disposition | volume = 32 | issue = 1 | pages = 105–12 | date = January 2004 | pmid = 14709627 | doi = 10.1124/dmd.32.1.105 | s2cid = 9869322 }}

{{cite journal | vauthors = Ghosal A, Ramanathan R, Yuan Y, Hapangama N, Chowdhury SK, Kishnani NS, Alton KB | s2cid = 1866233 | title = Identification of human liver cytochrome P450 enzymes involved in biotransformation of vicriviroc, a CCR5 receptor antagonist | journal = Drug Metabolism and Disposition | volume = 35 | issue = 12 | pages = 2186–95 | date = December 2007 | pmid = 17827338 | doi = 10.1124/dmd.107.017517 }}

{{cite journal | vauthors = Mitra R, Goodman OB | title = CYP3A5 regulates prostate cancer cell growth by facilitating nuclear translocation of AR | journal = The Prostate | volume = 75 | issue = 5 | pages = 527–38 | date = April 2015 | pmid = 25586052 | doi = 10.1002/pros.22940 | s2cid = 19910736 }}

}}

Category:CYP3A4 inhibitors

Category:Pleuromutilin antibiotics

Category:Experimental drugs