Azapetine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 458789808

| IUPAC_name = 6-prop-2-enyl-5,7-dihydrobenzo[d][2]benzazepine

| image = Azapetine.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 146-36-1

| ATC_prefix = C04

| ATC_suffix = AX30

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H17N/c1-2-11-18-12-14-7-3-5-9-16(14)17-10-6-4-8-15(17)13-18/h2-10H,1,11-13H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NYGHGTMKALXFIA-UHFFFAOYSA-N

| PubChem = 8966

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8620

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9TTR0UA2KC

| ChEMBL_Ref =

| ChEMBL = 2110596

| chemical_formula =

| C=17 | H=17 | N=1

| smiles = c3cc2c(c1c(cccc1)CN(C2)C\C=C)cc3

}}

Azapetine is a vasodilator.{{cite journal | vauthors = Stallworth JM, Jeffords JV | title = Clinical effects of azapetine (ilidar) on peripheral arterial disease | journal = Journal of the American Medical Association | volume = 161 | issue = 9 | pages = 840–3 | date = June 1956 | pmid = 13319017 | doi = 10.1001/jama.1956.02970090066013 }}{{cite journal | vauthors = Youmans PL, Green HD, Denison AB | title = Nature of the vasodilator and vasoconstrictor receptors in skeletal muscle of the dog | journal = Circulation Research | volume = 3 | issue = 2 | pages = 171–80 | date = March 1955 | pmid = 14352400 | doi = 10.1161/01.res.3.2.171 | url = http://circres.ahajournals.org/content/3/2/171.short | doi-access = free | url-access = subscription }}