Azapride
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 460328739
| IUPAC_name = 4-Azido-5-chloro-2-methoxy-N-[1-(phenylmethyl)piperidin-4-yl]benzamide
| image = Azapride.png
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 92990-90-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = URS8YWT9Q7
| ATC_prefix = None
| ATC_suffix =
| PubChem = 3036441
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2300456
| smiles = Clc1cc(c(OC)cc1/N=[N+]=[N-])C(=O)NC3CCN(Cc2ccccc2)CC3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H22ClN5O2/c1-28-19-12-18(24-25-22)17(21)11-16(19)20(27)23-15-7-9-26(10-8-15)13-14-5-3-2-4-6-14/h2-6,11-12,15H,7-10,13H2,1H3,(H,23,27)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CKKHIIXHAWWTNP-UHFFFAOYSA-N
| synonyms = Azidoclebopride
| C=20 | H=22 | Cl=1 | N=5 | O=2
}}
Azapride is the azide derivative of the dopamine antagonist clebopride synthesized in order to label dopamine receptors.{{cite journal | vauthors = Niznik HB, Guan JH, Neumeyer JL, Seeman P | title = A photoaffinity ligand for dopamine D2 receptors: azidoclebopride | journal = Molecular Pharmacology | volume = 27 | issue = 2 | pages = 193–9 | date = February 1985 | pmid = 3969068 }}{{cite journal | vauthors = Wouters W, Van Dun J, Laduron PM | title = Photoaffinity labelling of dopamine receptors. Synthesis and binding characteristics of azapride | journal = European Journal of Biochemistry | volume = 145 | issue = 2 | pages = 273–8 | date = December 1984 | pmid = 6548707 | doi = 10.1111/j.1432-1033.1984.tb08548.x | doi-access = free }} It is an irreversible dopamine antagonist.
References
{{reflist}}
{{Dopamine agonists}}
Category:Chlorobenzene derivatives
Category:Irreversible antagonists
{{nervous-system-drug-stub}}