Azapropazone

{{Short description|Nonsteroidal anti-inflammatory drug (NSAID)}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477351400

| IUPAC_name = (RS)-5-(Dimethylamino)-9-methyl-2-propyl-1H-pyrazolo[1,2-a][1,2,4]benzotriazine-1,3(2H)-dione

| image = azapropazone.svg

| image_class = skin-invert-image

| width = 200px

| chirality = Racemic mixture

| image2 = Azapropazone 3D spacefill.png

| image_class2 = bg-transparent

| alt2 = Azapropazone molecule

| tradename = Rheumox

| Drugs.com = {{drugs.com|international|azapropazone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK = POM

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 20 hours

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 13539-59-8

| ATC_prefix = M01

| ATC_suffix = AX04

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K2VOT966ZI

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02966

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1231131

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 38010

| PubChem = 26098

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24310

| smiles = O=C3N/1N(c2c(\N=C\1N(C)C)ccc(c2)C)C(=O)C3CCC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H20N4O2/c1-5-6-11-14(21)19-13-9-10(2)7-8-12(13)17-16(18(3)4)20(19)15(11)22/h7-9,11H,5-6H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MPHPHYZQRGLTBO-UHFFFAOYSA-N

| C=16 | H=20 | N=4 | O=2

}}

Azapropazone is a nonsteroidal anti-inflammatory drug (NSAID). It is manufactured by Goldshield under the tradename Rheumox.{{cite web | title = Rheumox Capsules | url = http://home.intekom.com/pharm/cont_eth/rheumox.html | work = South Africa Electronic Package Inserts | access-date = 2008-08-18 | archive-date = 2008-05-15 | archive-url = https://web.archive.org/web/20080515193315/http://home.intekom.com/pharm/cont_eth/rheumox.html | url-status = dead }}

It was available in the UK as a prescription-only drug, with restrictions due to certain contra-indications and side-effects.{{cite web | title = Azapropazone | url = http://www.patient.co.uk/showdoc/30002267/ | archive-url = https://web.archive.org/web/20090412081934/http://www.patient.co.uk/showdoc/30002267/ | archive-date = 12 April 2009 | work = Patient UK }} Azopropazone has now been discontinued in the British National Formulary.

Azapropazone has a half-life of approximately 20 hours in humans and is not extensively metabolized.{{cite journal | vauthors = Jones CJ | title = The pharmacology and pharmacokinetics of azapropazone - a review | journal = Current Medical Research and Opinion | volume = 4 | issue = 1 | pages = 3–16 | year = 1976 | pmid = 770078 | doi = 10.1185/03007997609109277 }}