Azidamfenicol

{{cs1 config|name-list-style=vanc}}

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 458965532

| IUPAC_name = 2-azido-N-((1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl)acetamide

| image = Azidamfenicol.svg

| tradename =

| Drugs.com = {{drugs.com|international|azidamfenicol}}

| pregnancy_category =

| legal_status = Rx only

| routes_of_administration = Topical (ocular)

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 13838-08-9

| ATC_prefix = S01

| ATC_suffix = AA25

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H13N5O5/c12-15-13-5-10(18)14-9(6-17)11(19)7-1-3-8(4-2-7)16(20)21/h1-4,9,11,17,19H,5-6H2,(H,14,18)/t9-,11-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SGRUZFCHLOFYHZ-MWLCHTKSSA-N

| PubChem = 62858

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 56590

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 40257685LM

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07411

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 278788

| C=11 | H=13 | N=5 | O=5

| smiles = [N-]=[N+]=N\CC(=O)N[C@@H]([C@H](O)c1ccc([N+]([O-])=O)cc1)CO

| melting_point = 99

| melting_high = 107

}}

Azidamfenicol is an amphenicol antibiotic,{{cite book | vauthors = de Groot AC | chapter = Chaper 3.26: Azidamfenicol|title=Topical Drugs | series = Monographs in Contact Allergy | volume = 3 |date=2021 |publisher=CRC Press |location=Boca Raton, FL |isbn=978-1-00-036786-7 |page=79 |edition=First | chapter-url = https://books.google.com/books?id=qSUMEAAAQBAJ&pg=PA79}} which has similar profile to chloramphenicol. It is used only topically, as eye drops and ointment for treatment of susceptible bacterial infections.{{cite book | vauthors = Sweetman SC |title=Martindale: The Complete Drug Reference |date=2007 |publisher=Pharmaceutical Press |location=London |isbn=978-0-85369-687-2 |edition=35th}}