Azidocillin
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444222259
| IUPAC_name = 6-[(2-azido-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
| image = Azidocillin.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Oral, IV, IM
| bioavailability = 57–64%
| protein_bound =
| metabolism =
| elimination_half-life = 0.6-1.1 hrs
| excretion = 37–50% active substance in urine
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 17243-38-8
| ATC_prefix = J01
| ATC_suffix = CE04
| PubChem = 71886
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB08795
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2105907
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16735689
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = R8XDP7L3SL
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07235
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 51758
| C=16 | H=17 | N=5 | O=4 | S=1
| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@H](\N=[N+]=[N-])c1ccccc1)[C@H]3SC2(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H17N5O4S/c1-16(2)11(15(24)25)21-13(23)10(14(21)26-16)18-12(22)9(19-20-17)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,22)(H,24,25)/t9-,10-,11+,14-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ODFHGIPNGIAMDK-NJBDSQKTSA-N
}}
Azidocillin is a type of penicillin.{{cite journal | vauthors = Axelsson A, Jensen C, Melin O, Singer F, von Sydow C | title = Treatment of acute maxillary sinusitis. V. Amoxicillin azidocillin, phenylpropanolamine and pivampicillin | journal = Acta Oto-Laryngologica | volume = 91 | issue = 3–4 | pages = 313–8 | year = 1981 | pmid = 6894819 | doi = 10.3109/00016488109138513 }}{{cite journal | vauthors = Bergan T, Sørensen G | title = Pharmacokinetics of azidocillin in healthy adults | journal = Arzneimittel-Forschung | volume = 30 | issue = 12 | pages = 2185–91 | year = 1980 | pmid = 6894241 }}