BD-1047

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 461748395

| IUPAC_name = N'-[2-(3,4-dichlorophenyl)ethyl]-N,N,N'-trimethylethane-1,2-diamine

| image = BD-1047 Structure.svg

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 6680

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 138356-20-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1S3X75QGDO

| ATC_prefix = none

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 143360

| PubChem = 188914

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 164154

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H20Cl2N2/c1-16(2)8-9-17(3)7-6-11-4-5-12(14)13(15)10-11/h4-5,10H,6-9H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = MGVRNMUKTZOQOW-UHFFFAOYSA-N

| C=13 | H=20 | Cl=2 | N=2

| smiles = Clc1ccc(CCN(C)CCN(C)C)cc1Cl

| melting_point =

| melting_high =

}}

BD-1047 is a sigma receptor antagonist, selective for the σ1 subtype. It has effects in animal studies suggestive of antipsychotic activity and may also be useful in the treatment of neuropathic pain.{{cite journal |vauthors=Skuza G, Rogóz Z |title=Effect of BD 1047, a sigma1 receptor antagonist, in the animal models predictive of antipsychotic activity |journal=Pharmacological Reports |volume=58 |issue=5 |pages=626–35 |year=2006 |pmid=17085854 }}{{cite journal |vauthors=Roh DH, Kim HW, Yoon SY, Seo HS, Kwon YB, Kim KW, Han HJ, Beitz AJ, Na HS, Lee JH |title=Intrathecal injection of the sigma(1) receptor antagonist BD1047 blocks both mechanical allodynia and increases in spinal NR1 expression during the induction phase of rodent neuropathic pain |journal=Anesthesiology |volume=109 |issue=5 |pages=879–89 |date=November 2008|pmid=18946301 |doi=10.1097/ALN.0b013e3181895a83 |doi-access=free }}

More recent studies also suggest a novel role for BD-1047 in attenuating ethanol-induced neurotoxicity in vitro, and additional research is being conducted on this compound as a possible pharmacotherapy for alcohol use disorder (AUD) {{cite journal |vauthors=Reynolds AR, Saunders MA, Prendergast MA |title=Ethanol Stimulates Endoplasmic Reticulum Inositol Triphosphate and Sigma Receptors to Promote Withdrawal-Associated Loss of Neuron-Specific Nuclear Protein/Fox-3. |journal=Alcohol Clin Exp Res |volume=40 |issue=7 |pages=1454–61 |year=2016 |pmid=27177604 |doi= 10.1111/acer.13097|pmc=6662182 }}

References

{{Sigma receptor modulators}}

Category:Sigma antagonists

{{nervous-system-drug-stub}}