BMS-202
{{Short description|Anti-tumour drug}}
{{cs1 config|name-list-style=vanc}}
{{Drugbox
| Verifiedfields =
| verifiedrevid =
| IUPAC_name = N-(2-(((2-methoxy-6-((2-methyl-[1,1'-biphenyl]-3-yl)methoxy)pyridin-3-yl)methyl)amino)ethyl)acetamide
| image = BMS-202.svg
| width = 300
| tradename =
| legal_status = Investigational
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 1675203-84-5
| ATC_prefix = none
| PubChem = 117951478
| ChemSpiderID = 45743495
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = KDA2HUE7KP
| IUPHAR_ligand = 9607
| ChEBI_Ref =
| ChEBI =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 4089730
| C=25 | H=29 | N=3 | O=3
| smiles = CC1=C(C=CC=C1C2=CC=CC=C2)COC3=NC(=C(C=C3)CNCCNC(=O)C)OC
| StdInChI = 1S/C25H29N3O3/c1-18-22(10-7-11-23(18)20-8-5-4-6-9-20)17-31-24-13-12-21(25(28-24)30-3)16-26-14-15-27-19(2)29/h4-13,26H,14-17H2,1-3H3,(H,27,29)
| StdInChIKey = JEDPSOYOYVELLZ-UHFFFAOYSA-N
}}
BMS-202 is a small-molecule drug PD-L1 inhibitor developed by Bristol-Myers Squibb which displays significant anti-tumor activity against glioblastoma (GBM) cells.{{cite journal | journal = Immunity, Inflammation and Disease | title = BMS-202, a PD-1/PD-L1 inhibitor, decelerates the pro‑fibrotic effects of fibroblasts derived from scar tissues via ERK and TGFβ1/Smad signaling pathways | date = 2022 | doi = 10.1002/iid3.693 | volume = 10 | issue = 10 | pages = e693 | pmid = 36169254 | pmc = 9449589 | vauthors = Cai Y, Xiao M, Li X, Zhou S, Sun Y, Yu W, Zhao T }} In addition, BMS-202 has an inhibitory effect on both PD-L1-expressing cancer cells and activated T cells.{{cite journal | journal = Biomedical Research | title = Antitumor activity of the PD-1/PD-L1 binding inhibitor BMS-202 in the humanized MHC-double knockout NOG mouse | date = 2019 | doi = 10.2220/biomedres.40.243 | volume = 40 | issue = 6 | pages = 243–250 | pmid = 31839668 | vauthors = Ashizawa T, Iizuka A, Tanaka E, Kondou R, Miyata H, Maeda C, Sugino T, Yamaguchi K, Ando T, Ishikawa Y, Ito M, Akiyama Y | doi-access = free }}