BMS-F
{{Short description|Chemical compound}}
{{drugbox
| drug_name = BMS-F
| image = BMS-F_structure.png
| image_class = skin-invert-image
| legal_UK =
| legal_DE =
| C = 27 | H = 33 | N = 3 | O = 5
| IUPAC_name = (S)-2-{[7-Methoxy-2-methyl-1-(2-morpholin-4-yl-ethyl)-1H-indole-3-carbonyl]-amino}-3-phenyl-propionic acid methyl ester
| CAS_number = 354569-07-6
| CAS_number_Ref = {{cascite|correct|CAS}}
| ChEMBL =
| ChemSpiderID =
| PubChem = 10227614
| UNII =
| smiles = CC1=C(C2=C(N1CCN3CCOCC3)C(=CC=C2)OC)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)OC
| StdInChI = 1S/C27H33N3O5/c1-19-24(26(31)28-22(27(32)34-3)18-20-8-5-4-6-9-20)21-10-7-11-23(33-2)25(21)30(19)13-12-29-14-16-35-17-15-29/h4-11,22H,12-18H2,1-3H3,(H,28,31)/t22-/m0/s1
| StdInChIKey = HQUJODHGYIPBGV-QFIPXVFZSA-N
}}
BMS-F is a chemical from the aminoalkylindole family invented by Bristol-Myers Squibb around 1999,{{cite patent | country = WO | number = 0158869 | status = application | title = Cannabinoid Receptor Modulators, Their Processes of Preparation, and use of Cannabinoid Receptor Modulators for Treating Respiratory and Non-Respiratory Diseases | pubdate = 16 August 2001 | fdate= 8 February 2001 |pridate= 11 February 2000 | inventor = Leftheris K, Zhao R, Chen BC, Kiener P, Wu H, Pandit CR, Wrobleski S, Chen P, Hynes J, Longphre M, Norris DJ, Spergel S, Tokarski J |assign1= Bristol-Myers Squibb }} that acts as a potent and selective agonist for the cannabinoid receptor CB2, with a Ki of 8 nM at CB2 and 500x selectivity over the related CB1 receptor. It has antiinflammatory effects and inhibits release of TNF-α.{{cite journal | vauthors = Hynes Jr J, Leftheris K, Wu H, Pandit C, Chen P, Norris DJ, Chen BC, Zhao R, Kiener PA, Chen X, Turk LA, Patil-Koota V, Gillooly KM, Shuster DJ, McIntyre KW | display-authors = 6 | title = C-3 Amido-indole cannabinoid receptor modulators | journal = Bioorganic & Medicinal Chemistry Letters | volume = 12 | issue = 17 | pages = 2399–2402 | date = September 2002 | pmid = 12161142 | doi = 10.1016/s0960-894x(02)00466-3 }}{{cite journal | vauthors = Howlett AC, Thomas BF, Huffman JW | title = The Spicy Story of Cannabimimetic Indoles | journal = Molecules | volume = 26 | issue = 20 | date = October 2021 | page = 6190 | pmid = 34684770 | doi = 10.3390/molecules26206190 | pmc = 8538531 | doi-access = free }}