Barium iodate

{{Chembox

| ImageFile = Α-Bariumiodat Struktur.png

| ImageSize = 250px

| ImageAlt = Crystal structure

| ImageCaption = Unit cell

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 10567-69-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ST2993NJ5J

| PubChem = 165892

| ChemSpiderID = 145385

| SMILES = [Ba+2].[O-]I(=O)=O.[O-]I(=O)=O

| InChI = 1/Ba.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2

| InChIKey = GASILTKHXWGKMG-NUQVWONBAR

| StdInChI = 1S/Ba.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2

| StdInChIKey = GASILTKHXWGKMG-UHFFFAOYSA-L }}

|Section2={{Chembox Properties

| Formula = Ba(IO₃)₂

| MolarMass = 487.13 g/mol

| Appearance =

| Density =

| MeltingPtC = 580

| MeltingPt_ref = (decomposes)

| BoilingPt =

| Solubility =

| SolubilityProduct = 1.57 × 10⁻⁹{{cite book |author1=John Rumble |title=CRC Handbook of Chemistry and Physics |date=June 18, 2018 |publisher=CRC Press |isbn=978-1138561632 |pages=4–47|edition=99th |language=English}}

| MagSus = −122.5·10⁻⁶ cm³/mol}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Barium iodate is an inorganic chemical compound with the chemical formula Ba(IO₃)₂. It is a white, granular substance.