Barnidipine
{{Short description|Antihypertensive drug of the calcium channel blocker class}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 459522276
| IUPAC_name = 3-(3R)-1-Benzylpyrrolidin-3-yl 5-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
| image = Barnidipine structure.svg
| width = 250
| tradename =
| Drugs.com = {{drugs.com|international|barnidipine}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Oral
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|CAS}}
| CAS_number = 104713-75-9
| ATC_prefix = C08
| ATC_suffix = CA12
| ATC_supplemental =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2103761
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2VBY96ASWJ
| PubChem = 443869
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 391959
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C27H29N3O6/c1-17-23(26(31)35-3)25(20-10-7-11-21(14-20)30(33)34)24(18(2)28-17)27(32)36-22-12-13-29(16-22)15-19-8-5-4-6-9-19/h4-11,14,22,25,28H,12-13,15-16H2,1-3H3/t22-,25-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = VXMOONUMYLCFJD-DHLKQENFSA-N
| C=27 | H=29 | N=3 | O=6
| smiles = [O-][N+](=O)c1cccc(c1)[C@H]4C(/C(=O)OC)=C(\N\C(=C4\C(=O)O[C@H]3CCN(Cc2ccccc2)C3)C)C
}}
Barnidipine (INN; also known as mepirodipine) is a calcium channel blocker which belongs to the dihydropyridine (DHP) group of calcium channel blockers. It is used in the treatment of hypertension.{{PubChem|443869}}
Pharmacodynamics
Barnidipine is a pure S,S isomer, a lipophilic 1,4-dihydropyridine calcium channel blocker, which, like other compounds in the class, shows a high affinity for calcium channels, particularly the L-type slow channels of smooth muscle cells found in the vessel wall.{{cite journal | vauthors = van Zwieten PA | title = Pharmacological profile of barnidipine: a single optical isomer dihydropyridine calcium antagonist | journal = Blood Pressure. Supplement | volume = 1 | pages = 5–8 | date = 1998 | pmid = 9660520 }} Calcium channel blocking drugs have the characteristic of interfering with the flow of calcium ions into the interior of cells through the slow channels of the plasma membrane.
References
{{reflist}}
{{Calcium channel blockers}}
Category:Calcium channel blockers
Category:3-Nitrophenyl compounds
{{Cardiovascular-drug-stub}}