Basic Red 18

{{Chembox

| ImageFile = BasicRed18.png

| ImageSize = 322

| ImageAlt =

| IUPACName =

| OtherNames = Aizen Cathilon Red GTLH, Astrazon Red GTL

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 25198-22-5

| PubChem = 26457

| ChemSpiderID = 21160230

| EC_number = 237-946-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII =H5KZY0428H

| InChI=1S/C19H25ClN5O2/c1-5-23(12-13-25(2,3)4)16-8-6-15(7-9-16)21-22-19-11-10-17(24(26)27)14-18(19)20/h6-11,14H,5,12-13H2,1-4H3/q+1

| InChIKey = TZXATTMVGZDPHM-UHFFFAOYSA-N

| SMILES = CCN(CC[N+](C)(C)C)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])Cl

}}

|Section2={{Chembox Properties

| C=19|H=25|N=5|Cl=2|O=2

| MolarMass =

| Appearance = dark red solid

| Density =

| MeltingPtC = 45.5-46.5

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHSSignalWord = Danger

| GHSPictograms = {{GHS05}}{{GHS07}}

| HPhrases = {{H-phrases|302|318|412}}

| PPhrases = {{P-phrases|264|270|273|280|301+312|305+351+338|310|330|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Basic Red 18 is a cationic azo dye used for coloring textiles. The chromophore is the cation, which contains many functional groups, but most prominently the quaternary ammonium center.

It is produced by azo coupling of 2-chloro-4-nitrophenyldiazonium cation with the quaternary ammonium salt derived from N-ethyl-N-(2-chloroethyl)aniline and trimethylamine.{{cite encyclopedia|author=Klaus Hunger|author2=Peter Mischke|author3=Wolfgang Rieper|display-authors=etal|title=Azo Dyes|encyclopedia=Ullmann’s Encyclopedia of Industrial Chemistry|year=2005|publisher=Wiley-VCH|place=Weinheim|doi=10.1002/14356007.a03_245|isbn=3527306730}}.

Like many dyes, methods for the removal of Basic Red 18 from waste streams has received much attention.{{cite journal|journal=Dyes and Pigments|volume=76|year=2008|pages=784–791|title=Adsorption of binary mixtures of cationic dyes|author=B.Noroozi|author2=G. A.Sorial|author3=H.Bahrami|author4=M.Arami|issue=3|doi=10.1016/j.dyepig.2007.02.003}}

References