Bendazac

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447984244

| IUPAC_name = [(1-benzyl-1H-indazol-3-yl)oxy]acetic acid

| image = Bendazac.svg

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|bendazac}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Topical

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 20187-55-7

| ATC_prefix = M02

| ATC_suffix = AA11

| ATC_supplemental = {{ATC|S01|BC07}}

| PubChem = 2313

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2223

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G4AG71204O

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01594

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 31257

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1089221

| C=16 | H=14

| N=2 | O=3

| smiles = O=C(O)COc2nn(c1ccccc12)Cc3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H14N2O3/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BYFMCKSPFYVMOU-UHFFFAOYSA-N

}}

Bendazac (or bendazolic acid) is a nonsteroidal anti-inflammatory drug (NSAID) used for joint and muscular pain.{{cite journal | vauthors = Balfour JA, Clissold SP | title = Bendazac lysine. A review of its pharmacological properties and therapeutic potential in the management of cataracts | journal = Drugs | volume = 39 | issue = 4 | pages = 575–96 | date = April 1990 | pmid = 2190795 | doi = 10.2165/00003495-199039040-00007 | s2cid = 46956362 }}