Benocyclidine
{{Short description|Chemical compound}}
{{Redirect|BTCP}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461744968
| IUPAC_name = 1-[1-(1-Benzothiophen-2-yl)cyclohexyl]piperidine
| image = Benocyclidine Structure.svg
| image_class = skin-invert-image
| tradename =
| licence_EU =
| pregnancy_category =
| legal_UK = PSA
| legal_US = Unscheduled, illegal in Florida and Virginia
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 112726-66-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q1WR6UP7MW
| ATC_prefix = none
| ATC_suffix =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 279556
| PubChem = 123692
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 110266
| C=19 | H=25 | N=1 | S=1
| smiles = C1(SC(C2(CCCCC2)N3CCCCC3)=C4)=C4C=CC=C1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H25NS/c1-5-11-19(12-6-1,20-13-7-2-8-14-20)18-15-16-9-3-4-10-17(16)21-18/h3-4,9-10,15H,1-2,5-8,11-14H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RGSVXQJPSWZXOP-UHFFFAOYSA-N
}}
Benocyclidine, also known as benzo{{wbr}}thiophenyl{{wbr}}cyclo{{wbr}}hexylpiperidine (BTCP), is a psychoactive recreational drug of the arylcyclohexylamine class which is related to phencyclidine (PCP). It was first described in a patent application naming Marc Caron and colleagues at Duke University in 1997.PCT Patent Application WO199712513 (see also US Patents Nos.5,866,756 and 6,218,595
It acts as a potent and selective dopamine reuptake inhibitor (DRI) and a psychostimulant.{{cite journal |vauthors=Vignon J, Pinet V, Cerruti C, Kamenka JM, Chicheportiche R | title = [3H]N-[1-(2-benzo(b)thiophenyl)cyclohexyl]piperidine ([3H]BTCP): a new phencyclidine analog selective for the dopamine uptake complex. | journal = Eur J Pharmacol | volume = 148 | issue = 3 | pages = 427–436 | year = 1998 | pmid = 3384005 | doi = 10.1016/0014-2999(88)90122-7 }}{{cite journal |vauthors=Chaudieu I, Vignon J, Chicheportiche M, Kamenka JM, Trouiller G, Chicheportiche R | title = Role of the aromatic group in the inhibition of phencyclidine binding and dopamine uptake by PCP analogs. | journal = Pharmacol Biochem Behav | volume = 32 | issue = 3 | pages = 699–705 | year = 1989 | pmid = 2544905 | doi = 10.1016/0091-3057(89)90020-8 | s2cid = 7672918 }} Unlike related compounds like phencyclidine and ketamine, benocyclidine is a pure DRI with negligible affinity for the NMDA receptor, and it therefore lacks any anticonvulsant, anesthetic, hallucinogenic, or dissociative effects. It has been used to label the dopamine transporter.{{cite journal |vauthors=Filloux F, Hunt MA, Wamsley JK | title = Localization of the dopamine uptake complex using [3H]N-[1-(2-benzo(b)thiophenyl)cyclohexyl]piperidine ([3H]BTCP) in rat brain. | journal = Neurosci. Lett. | volume = 100 | issue = 1–3 | pages = 105–110 | year = 1989 | pmid = 2527343 | doi = 10.1016/0304-3940(89)90668-X | s2cid = 9985692 }}{{cite journal |vauthors=Maurice T, Vignon J, Kamenka JM, Chicheportiche R | title = In vivo labelling of the mouse dopamine uptake complex with the phencyclidine derivative [3H]BTCP | journal = Neurosci. Lett. | volume = 101 | issue = 2 | pages = 234–238 | year = 1989 | pmid = 2771169 | doi = 10.1016/0304-3940(89)90537-5 | s2cid = 24176107 }} BCP was used to try to find a common pharmacophore for DRI type stimulants.{{cite journal|vauthors=Froimowitz M, Wu KM, Rodrigo J, George C | title=Conformational preferences of the potent dopamine reuptake blocker BTCP and its analogs and their incorporation into a pharmacophore model | journal=J Comput Aided Mol Des | year= 2000 | volume= 14 | issue= 2 | pages= 135–46 | pmid=10721502| doi=10.1023/A:1008144707255 | bibcode=2000JCAMD..14..135F | s2cid=6754086 }}
More recently, benocyclidine has been found in several ecstasy tablets, sold as MDMA.{{cite web|title=EcstasyData Testing Result: Blue Butterfly|url=http://www.ecstasydata.org/view.php?id=2307|work=Ecstasy and other drug testing|publisher=Erowid Center|access-date=2 February 2012}}
Legal status in the United States
Benocyclidine is a Schedule I controlled substance in the state of Florida and Virginia, making it illegal to buy, sell, or possess in these states.{{cite web |title=§ 54.1-3446. Schedule I. |url=https://law.lis.virginia.gov/vacode/title54.1/chapter34/section54.1-3446/ |website=Virginia Law |access-date=14 September 2023}}{{cite web |url=http://leg.state.fl.us/statutes/index.cfm?App_mode=Display_Statute&URL=0800-0899/0893/0893.html |title=Florida Statutes - Chapter 893 - DRUG ABUSE PREVENTION AND CONTROL}}
Otherwise, benocyclidine is not scheduled at the federal level in the United States,{{cite web |url=http://www.deadiversion.usdoj.gov/21cfr/cfr/1308/1308_11.htm |title=21 CFR — SCHEDULES OF CONTROLLED SUBSTANCES §1308.11 Schedule I |access-date=2014-12-17 |archive-date=2009-08-27 |archive-url=https://web.archive.org/web/20090827043725/http://www.deadiversion.usdoj.gov/21cfr/cfr/1308/1308_11.htm |url-status=dead }} but may be considered an analog of PCP, in which case purchase, sale, or possession could be prosecuted under the Federal Analog Act if intended for human consumption.