Benocyclidine

{{Short description|Chemical compound}}

{{Redirect|BTCP}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461744968

| IUPAC_name = 1-[1-(1-Benzothiophen-2-yl)cyclohexyl]piperidine

| image = Benocyclidine Structure.svg

| image_class = skin-invert-image

| tradename =

| licence_EU =

| pregnancy_category =

| legal_UK = PSA

| legal_US = Unscheduled, illegal in Florida and Virginia

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 112726-66-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q1WR6UP7MW

| ATC_prefix = none

| ATC_suffix =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 279556

| PubChem = 123692

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 110266

| C=19 | H=25 | N=1 | S=1

| smiles = C1(SC(C2(CCCCC2)N3CCCCC3)=C4)=C4C=CC=C1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H25NS/c1-5-11-19(12-6-1,20-13-7-2-8-14-20)18-15-16-9-3-4-10-17(16)21-18/h3-4,9-10,15H,1-2,5-8,11-14H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RGSVXQJPSWZXOP-UHFFFAOYSA-N

}}

Benocyclidine, also known as benzo{{wbr}}thiophenyl{{wbr}}cyclo{{wbr}}hexylpiperidine (BTCP), is a psychoactive recreational drug of the arylcyclohexylamine class which is related to phencyclidine (PCP). It was first described in a patent application naming Marc Caron and colleagues at Duke University in 1997.PCT Patent Application WO199712513 (see also US Patents Nos.5,866,756 and 6,218,595

It acts as a potent and selective dopamine reuptake inhibitor (DRI) and a psychostimulant.{{cite journal |vauthors=Vignon J, Pinet V, Cerruti C, Kamenka JM, Chicheportiche R | title = [3H]N-[1-(2-benzo(b)thiophenyl)cyclohexyl]piperidine ([3H]BTCP): a new phencyclidine analog selective for the dopamine uptake complex. | journal = Eur J Pharmacol | volume = 148 | issue = 3 | pages = 427–436 | year = 1998 | pmid = 3384005 | doi = 10.1016/0014-2999(88)90122-7 }}{{cite journal |vauthors=Chaudieu I, Vignon J, Chicheportiche M, Kamenka JM, Trouiller G, Chicheportiche R | title = Role of the aromatic group in the inhibition of phencyclidine binding and dopamine uptake by PCP analogs. | journal = Pharmacol Biochem Behav | volume = 32 | issue = 3 | pages = 699–705 | year = 1989 | pmid = 2544905 | doi = 10.1016/0091-3057(89)90020-8 | s2cid = 7672918 }} Unlike related compounds like phencyclidine and ketamine, benocyclidine is a pure DRI with negligible affinity for the NMDA receptor, and it therefore lacks any anticonvulsant, anesthetic, hallucinogenic, or dissociative effects. It has been used to label the dopamine transporter.{{cite journal |vauthors=Filloux F, Hunt MA, Wamsley JK | title = Localization of the dopamine uptake complex using [3H]N-[1-(2-benzo(b)thiophenyl)cyclohexyl]piperidine ([3H]BTCP) in rat brain. | journal = Neurosci. Lett. | volume = 100 | issue = 1–3 | pages = 105–110 | year = 1989 | pmid = 2527343 | doi = 10.1016/0304-3940(89)90668-X | s2cid = 9985692 }}{{cite journal |vauthors=Maurice T, Vignon J, Kamenka JM, Chicheportiche R | title = In vivo labelling of the mouse dopamine uptake complex with the phencyclidine derivative [3H]BTCP | journal = Neurosci. Lett. | volume = 101 | issue = 2 | pages = 234–238 | year = 1989 | pmid = 2771169 | doi = 10.1016/0304-3940(89)90537-5 | s2cid = 24176107 }} BCP was used to try to find a common pharmacophore for DRI type stimulants.{{cite journal|vauthors=Froimowitz M, Wu KM, Rodrigo J, George C | title=Conformational preferences of the potent dopamine reuptake blocker BTCP and its analogs and their incorporation into a pharmacophore model | journal=J Comput Aided Mol Des | year= 2000 | volume= 14 | issue= 2 | pages= 135–46 | pmid=10721502| doi=10.1023/A:1008144707255 | bibcode=2000JCAMD..14..135F | s2cid=6754086 }}

More recently, benocyclidine has been found in several ecstasy tablets, sold as MDMA.{{cite web|title=EcstasyData Testing Result: Blue Butterfly|url=http://www.ecstasydata.org/view.php?id=2307|work=Ecstasy and other drug testing|publisher=Erowid Center|access-date=2 February 2012}}

Legal status in the United States

Benocyclidine is a Schedule I controlled substance in the state of Florida and Virginia, making it illegal to buy, sell, or possess in these states.{{cite web |title=§ 54.1-3446. Schedule I. |url=https://law.lis.virginia.gov/vacode/title54.1/chapter34/section54.1-3446/ |website=Virginia Law |access-date=14 September 2023}}{{cite web |url=http://leg.state.fl.us/statutes/index.cfm?App_mode=Display_Statute&URL=0800-0899/0893/0893.html |title=Florida Statutes - Chapter 893 - DRUG ABUSE PREVENTION AND CONTROL}}

Otherwise, benocyclidine is not scheduled at the federal level in the United States,{{cite web |url=http://www.deadiversion.usdoj.gov/21cfr/cfr/1308/1308_11.htm |title=21 CFR — SCHEDULES OF CONTROLLED SUBSTANCES §1308.11 Schedule I |access-date=2014-12-17 |archive-date=2009-08-27 |archive-url=https://web.archive.org/web/20090827043725/http://www.deadiversion.usdoj.gov/21cfr/cfr/1308/1308_11.htm |url-status=dead }} but may be considered an analog of PCP, in which case purchase, sale, or possession could be prosecuted under the Federal Analog Act if intended for human consumption.

See also

References