Benz(e)acephenanthrylene
{{short description|Chemical compound}}
{{DISPLAYTITLE:Benz(e)acephenanthrylene}}{{correct title|reason=bracket|edit=substitution|Benz[e]acephenanthrylene}}
{{Chembox
| Name = Benz[e]acephenanthrylene{{cite web |author=Staff |title=Benz[e]acephenanthrylene |url=http://webbook.nist.gov/cgi/cbook.cgi?ID=C205992&Units=SI&Mask=1EFF |date=2011 |work=NIST |accessdate=March 5, 2014 }}{{cite web |author=Staff |title=Benzo[e]acephenanthrylene |url=http://www.chemspider.com/Chemical-Structure.8799.html?rid=8ece8710-3560-40c0-a4a4-a185793d8787 |date=2014 |work=ChemSpider |accessdate=March 5, 2014 }}
| ImageFile= NIST-Benz-e-acephenanthrylene-20140305.png
| PIN= Benzo[e]acephenanthrylene
| OtherNames= Benzo[b]fluoranthene; Benzo[e]fluoranthene; 2,3-Benzofluoranthrene; B[b]F; 2,3-Benzofluoranthene; 4,5-Benzofluoranthene; 2,3-Benzfluoranthene; 3,4-Benzfluoranthene; 3,4-Benzofluoranthene; Benz[b]fluoranthene
|Section1={{Chembox Identifiers
| CASNo = 205-99-2
| InChIKey =
| StdInChIKey =
| ChemSpiderID = 8799
| PubChem = 9153
| EC_number = 205-911-9
| RTECS = CU1400000
| UNNumber = 2811, 3077
| UNII = FJO154KG1X
| ChEBI = 34565
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1797274
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C14320
| InChI = 1S/C20H12/c1-2-7-14-13(6-1)12-19-16-9-4-3-8-15(16)18-11-5-10-17(14)20(18)19/h1-12H
| StdInChI = FTOVXSOBNPWTSH-UHFFFAOYSA-N
| SMILES = C1=CC=C2C3=C4C(=CC=C3)C5=CC=CC=C5C4=CC2=C1
| MeSHName=
}}
|Section2={{Chembox Properties
| C=20 | H=12
| Appearance = Off-white to tan powder
| Density = 1.286 g/cm3
| MeltingPtC = 166
| BoilingPtC = 481
}}
|Section3={{Chembox Hazards
| FlashPt=
| GHSPictograms = {{GHS08}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|350|410}}
| PPhrases = {{P-phrases|201|202|273|281|308+313|391|405|501}}
}}
}}
Benz[e]acephenanthrylene is an organic compound with the chemical formula C20H12. It is a polycyclic aromatic hydrocarbon (PAH) made of four benzene rings around a 5-membered ring.
See also
References
{{reflist}}
External links
- {{ICSC|0720|01}}
- [http://www.npi.gov.au/resource/polycyclic-aromatic-hydrocarbons National Pollutant Inventory - Polycyclic Aromatic Hydrocarbon Fact Sheet]
{{PAHs}}
Category:Polycyclic aromatic hydrocarbons
Category:IARC Group 2B carcinogens
{{hydrocarbon-stub}}