Benz(e)acephenanthrylene

{{short description|Chemical compound}}

{{DISPLAYTITLE:Benz(e)acephenanthrylene}}{{correct title|reason=bracket|edit=substitution|Benz[e]acephenanthrylene}}

{{Chembox

| Name = Benz[e]acephenanthrylene{{cite web |author=Staff |title=Benz[e]acephenanthrylene |url=http://webbook.nist.gov/cgi/cbook.cgi?ID=C205992&Units=SI&Mask=1EFF |date=2011 |work=NIST |accessdate=March 5, 2014 }}{{cite web |author=Staff |title=Benzo[e]acephenanthrylene |url=http://www.chemspider.com/Chemical-Structure.8799.html?rid=8ece8710-3560-40c0-a4a4-a185793d8787 |date=2014 |work=ChemSpider |accessdate=March 5, 2014 }}

| ImageFile= NIST-Benz-e-acephenanthrylene-20140305.png

| PIN= Benzo[e]acephenanthrylene

| OtherNames= Benzo[b]fluoranthene; Benzo[e]fluoranthene; 2,3-Benzofluoranthrene; B[b]F; 2,3-Benzofluoranthene; 4,5-Benzofluoranthene; 2,3-Benzfluoranthene; 3,4-Benzfluoranthene; 3,4-Benzofluoranthene; Benz[b]fluoranthene

|Section1={{Chembox Identifiers

| CASNo = 205-99-2

| CASNo_Comment =

| InChIKey =

| StdInChIKey =

| ChemSpiderID = 8799

| PubChem = 9153

| EC_number = 205-911-9

| RTECS = CU1400000

| UNNumber = 2811, 3077

| UNII = FJO154KG1X

| ChEBI = 34565

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1797274

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C14320

| ChemSpiderID_Comment =

| InChI = 1S/C20H12/c1-2-7-14-13(6-1)12-19-16-9-4-3-8-15(16)18-11-5-10-17(14)20(18)19/h1-12H

| InChI_Comment =

| StdInChI = FTOVXSOBNPWTSH-UHFFFAOYSA-N

| StdInChI_Comment=

| SMILES = C1=CC=C2C3=C4C(=CC=C3)C5=CC=CC=C5C4=CC2=C1

| SMILES_Comment=

| MeSHName=

}}

|Section2={{Chembox Properties

| C=20 | H=12

| Appearance = Off-white to tan powder

| Density = 1.286 g/cm³

| MeltingPtC = 166

| MeltingPt_ref =

| BoilingPtC = 481

}}

|Section3={{Chembox Hazards

| FlashPt=

| GHSPictograms = {{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|350|410}}

| PPhrases = {{P-phrases|201|202|273|281|308+313|391|405|501}}

}}

}}

Benz[e]acephenanthrylene is an organic compound with the chemical formula C₂₀H₁₂. It is a polycyclic aromatic hydrocarbon (PAH) made of four benzene rings around a 5-membered ring.