Benzamidenafil

{{Chembox

| ImageFile = Benzamidenafil.svg

| ImageSize = 200px

| ImageAlt =

| PIN = N-[(3,4-Dimethoxyphenyl)methyl]-2-[(1-hydroxypropan-2-yl)amino]-5-nitrobenzamide

| OtherNames = Xanthoanthrafil

|Section1={{Chembox Identifiers

| CASNo = 1020251-53-9

| SMILES = COC1=C(OC)C=C(CNC(=O)C2=CC(=CC=C2NC(C)CO)[N+]([O-])=O)C=C1

| PubChem = 10110873

| ChemSpiderID = 8286399

| UNII = B6ZMZ878RF

| InChI = 1/C19H23N3O6/c1-12(11-23)21-16-6-5-14(22(25)26)9-15(16)19(24)20-10-13-4-7-17(27-2)18(8-13)28-3/h4-9,12,21,23H,10-11H2,1-3H3,(H,20,24)

| InChIKey = ZISFCTXLAXIEMV-UHFFFAOYAW

| StdInChI = 1S/C19H23N3O6/c1-12(11-23)21-16-6-5-14(22(25)26)9-15(16)19(24)20-10-13-4-7-17(27-2)18(8-13)28-3/h4-9,12,21,23H,10-11H2,1-3H3,(H,20,24)

| StdInChIKey = ZISFCTXLAXIEMV-UHFFFAOYSA-N

| RTECS =

| MeSHName = C442640

}}

|Section2={{Chembox Properties

| C=19 | H=23 | N=3 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

{{update|date=March 2024}}

Benzamidenafil or xanthoanthrafil is a synthetic drug that acts as a PDE5 inhibitor. It has the same mechanism of action as pharmaceutical drugs used to treat erectile dysfunction, but it is not approved by any regulatory agency for such use.

The drug has been found as an undeclared adulterant in supposedly "natural" health supplements.{{cite journal |title = Identification of benzamidenafil, a new class of phosphodiesterase-5 inhibitor, as an adulterant in a dietary supplement |journal = Journal of Pharmaceutical and Biomedical Analysis |year = 2008 |volume = 47 |issue = 2 | pages = 255–259 | doi = 10.1016/j.jpba.2008.01.004| last1 = Zou | first1 = Peng | last2 = Hou | first2 = Peiling | last3 = Oh | first3 = Sharon Sze-Yin | last4 = Ge | first4 = Xiaowei | last5 = Bloodworth | first5 = Bosco Chen | last6 = Low | first6 = Min-Yong | last7 = Koh | first7 = Hwee-Ling | pmid = 18280079 }} In 2009, the supplement manufacturer Hi-Tech Pharmaceuticals recalled its product Stamina-Rx because it was adulterated with benzamidenafil.{{Cite web |last=Miranda Hitti |title=Stamina-Rx Supplements Recalled |url=https://www.webmd.com/erectile-dysfunction/news/20090617/stamina-rx-supplements-recalled |access-date=2022-08-17 |website=WebMD |language=en}}