Benzilone

{{Short description|Chemical compound}}

{{Distinguish|Benzylone}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443417081

| IUPAC_name = 1,1-diethyl-3-(2-hydroxy-2,2-diphenylacetoxy)pyrrolidinium

| image = Benzilone.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 16175-92-1

| CAS_supplemental =
{{CAS|1050-48-2}} (bromide)

| ATC_prefix = A03

| ATC_suffix = AB01

| PubChem = 66248

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2106061

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GY56LQX77B

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 59632

| smiles = O=C(OC1CC[N+](CC)(CC)C1)C(O)(c2ccccc2)c3ccccc3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H28NO3/c1-3-23(4-2)16-15-20(17-23)26-21(24)22(25,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20,25H,3-4,15-17H2,1-2H3/q+1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZKCWITXZGWUJAV-UHFFFAOYSA-N

| C=22 | H=28 | N=1 | O=3

}}

Benzilone is an antimuscarinic drug.{{cite web | work = KEGG database | url = http://www.genome.jp/dbget-bin/www_bget?drug+D03088 |title = Benzilone | access-date = 9 May 2015 }}{{cite journal | vauthors = Schwartz TW, Stenquist B, Olbe L, Stadil F | title = Synchronous oscillations in the basal secretion of pancreatic-polypeptide and gastric acid. Depression by cholinergic blockade of pancreatic-polypeptide concentrations in plasma | journal = Gastroenterology | volume = 76 | issue = 1 | pages = 14–9 | date = January 1979 | pmid = 758136 | doi = 10.1016/s0016-5085(79)80121-3 | quote = Benzilonium bromide (Parke, Davis & Co., Detroit Mich.) is a quarternary [sic] antimuscarinic agent with minimal passage of the blood-brain barrier. | doi-access = free }}