Benzotript

{{Short description|Cholecystokinin antagonist}}

{{Cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Benzotript.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 39544-74-6

| CAS_supplemental =

| PubChem = 2060890

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 1553298

| UNII = LS5O682BRO

| KEGG =

| ChEBI =

| ChEMBL = 63544

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Benzotrypt; CR-501; N-(p-Chlorobenzoyl)-L-tryptophan; N-(4-Chlorobenzoyl)-L-tryptophan; N-[(4-Chlorophenyl)carbonyl]tryptophan

| IUPAC_name = (2S)-2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid

| C=18 | H=15 | Cl=1 | N=2 | O=3

| SMILES = C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)C3=CC=C(C=C3)Cl

| StdInChI = 1S/C18H15ClN2O3/c19-13-7-5-11(6-8-13)17(22)21-16(18(23)24)9-12-10-20-15-4-2-1-3-14(12)15/h1-8,10,16,20H,9H2,(H,21,22)(H,23,24)/t16-/m0/s1

| StdInChIKey = QJERBBQXOMUURJ-INIZCTEOSA-N

}}

Benzotript ({{Abbrlink|INN|International Nonproprietary Name}}), also known as N-(p-chlorobenzoyl)-L-tryptophan, is a muscle relaxant that inhibits gastric secretion and was never marketed.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1262 | access-date=8 October 2024 | page=1262}}{{cite journal | vauthors = Herranz R | title = Cholecystokinin antagonists: pharmacological and therapeutic potential | journal = Med Res Rev | volume = 23 | issue = 5 | pages = 559–605 | date = September 2003 | pmid = 12789687 | doi = 10.1002/med.10042 | url = }} It is a tryptamine derivative and the N-(4-chlorobenzoyl) analogue of the amino acid tryptophan. Similarly to proglumide (N²-benzoyl-N,N-dipropyl-α-glutamine), the drug acts as a competitive and non-selective cholecystokinin receptor antagonist.{{cite journal | vauthors = Maton PN, Jensen RT, Gardner JD | title = Cholecystokinin antagonists | journal = Horm Metab Res | volume = 18 | issue = 1 | pages = 2–9 | date = January 1986 | pmid = 2419234 | doi = 10.1055/s-2007-1012212 | url = }} Other more potent tryptophan derivatives have also been developed as cholecystokinin (CCK) antagonists.