Benzthiazide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 459955213

| IUPAC_name = 6-chloro-1,1-dioxo-3-(phenylmethylsulfanylmethyl)- 4H-benzo[e][1,2,4]thiadiazine-7-sulfonamide

| image = Benzthiazide.svg

| tradename =

| Drugs.com = {{drugs.com|international|benzthiazide}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability = 60 to 70%

| protein_bound = 30%

| metabolism =

| elimination_half-life = 5 to 15 hours

| excretion = Renal

| IUPHAR_ligand = 7125

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 91-33-8

| ATC_prefix = none

| ATC_suffix =

| PubChem = 2343

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00562

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2253

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1TD8J48L61

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00651

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3047

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201039

| C=15 | H=14

| Cl=1 | N=3

| O=4 | S=3

| smiles = O=S(=O)(c1c(Cl)cc2c(c1)S(=O)(=O)/N=C(\N2)CSCc3ccccc3)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H14ClN3O4S3/c16-11-6-12-14(7-13(11)25(17,20)21)26(22,23)19-15(18-12)9-24-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,18,19)(H2,17,20,21)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NDTSRXAMMQDVSW-UHFFFAOYSA-N

}}

Benzthiazide (BAN/INN, also known as benzothiazide; trade names Aquatag, Dihydrex, Diucen, Edemax, Exna, Foven and others{{cite book | vauthors = Triggle DJ, Ganellin CR, MacDonald F |title=Dictionary of Pharmacological Agents |publisher=Chapman & Hall/CRC |location=Boca Raton |year=1996 |volume=1 |pages=246 |isbn=0-412-46630-9 |url=https://books.google.com/books?id=DeX7jgInYFMC}} Retrieved on August 29, 2008 through Google Book Search.) is a thiazide diuretic used in the treatment of high blood pressure and edema. It is no longer available in the United States.

In the United Kingdom, it was also sold in combination with the potassium-sparing diuretic triamterene under the trade name Dytide.{{cite web |url=http://www.patient.co.uk/showdoc/30002902 |title=Triamterene and Benzthiazide |date=2005 |publisher=PatientUK |accessdate=2008-08-29}} The same combination is still available in Switzerland as Dyrenium compositum.{{cite web|url=http://www.doetschgrether.ch/de/Dyrenium_Detail.asp |title=Dyrenium compositum |date=n.d. |publisher=Doetsch Grether |accessdate=2008-08-29 |url-status=dead |archiveurl=https://web.archive.org/web/20070211161238/http://www.doetschgrether.ch/de/Dyrenium_Detail.asp |archivedate=February 11, 2007 }}

References